EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C15H14ClN4O6S |
| Net Charge | -1 |
| Average Mass | 413.819 |
| Monoisotopic Mass | 413.03281 |
| SMILES | CCOC(=O)c1ccccc1S(=O)(=O)[N-]C(=O)Nc1nc(Cl)cc(OC)n1 |
| InChI | InChI=1S/C15H15ClN4O6S/c1-3-26-13(21)9-6-4-5-7-10(9)27(23,24)20-15(22)19-14-17-11(16)8-12(18-14)25-2/h4-8H,3H2,1-2H3,(H2,17,18,19,20,22)/p-1 |
| InChIKey | NSWAMPCUPHPTTC-UHFFFAOYSA-M |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| chlorimuron-ethyl(1−) (CHEBI:188144) is a N-sulfonylurea (CHEBI:76983) |
| chlorimuron-ethyl(1−) (CHEBI:188144) is a sulfamoylbenzoate (CHEBI:48471) |
| chlorimuron-ethyl(1−) (CHEBI:188144) is conjugate base of chlorimuron-ethyl (CHEBI:47319) |
| Incoming Relation(s) |
| chlorimuron-ethyl (CHEBI:47319) is conjugate acid of chlorimuron-ethyl(1−) (CHEBI:188144) |
| UniProt Name | Source |
|---|---|
| chlorimuron-ethyl | UniProt |