EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C13H11ClN4O6S |
| Net Charge | 0 |
| Average Mass | 386.773 |
| Monoisotopic Mass | 386.00878 |
| SMILES | COc1cc(Cl)nc(NC(=O)NS(=O)(=O)c2ccccc2C(=O)O)n1 |
| InChI | InChI=1S/C13H11ClN4O6S/c1-24-10-6-9(14)15-12(16-10)17-13(21)18-25(22,23)8-5-3-2-4-7(8)11(19)20/h2-6H,1H3,(H,19,20)(H2,15,16,17,18,21) |
| InChIKey | RIUXZHMCCFLRBI-UHFFFAOYSA-N |
| Roles Classification |
|---|
| Chemical Role: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| Biological Role: | EC 2.2.1.6 (acetolactate synthase) inhibitor An EC 2.2.1.* (transketolase/transaldolase) inhibitor that interferes with the action of acetolactate synthase (EC 2.2.1.6). |
| Applications: | herbicide A substance used to destroy plant pests. pesticide Strictly, a substance intended to kill pests. In common usage, any substance used for controlling, preventing, or destroying animal, microbiological or plant pests. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| chlorimuron (CHEBI:81953) has role EC 2.2.1.6 (acetolactate synthase) inhibitor (CHEBI:22180) |
| chlorimuron (CHEBI:81953) has role herbicide (CHEBI:24527) |
| chlorimuron (CHEBI:81953) is a N-sulfonylurea (CHEBI:76983) |
| chlorimuron (CHEBI:81953) is a aromatic ether (CHEBI:35618) |
| chlorimuron (CHEBI:81953) is a benzoic acids (CHEBI:22723) |
| chlorimuron (CHEBI:81953) is a organochlorine pesticide (CHEBI:38656) |
| chlorimuron (CHEBI:81953) is a pyrimidines (CHEBI:39447) |
| chlorimuron (CHEBI:81953) is a sulfamoylbenzoate (CHEBI:48471) |
| Incoming Relation(s) |
| chlorimuron-ethyl (CHEBI:47319) has functional parent chlorimuron (CHEBI:81953) |
| IUPAC Name |
|---|
| 2-{[(4-chloro-6-methoxypyrimidin-2-yl)carbamoyl]sulfamoyl}benzoic acid |
| Synonyms | Source |
|---|---|
| 2-[[[[(4-chloro-6-methoxy-2-pyrimidinyl)amino]carbonyl]amino]sulfonyl]benzoic acid | Alan Wood's Pesticides |
| 2-(4-chloro-6-methoxypyrimidin-2-ylcarbamoylsulfamoyl)benzoic acid | Alan Wood's Pesticides |
| Manual Xrefs | Databases |
|---|---|
| 3031 | PPDB |
| C18777 | KEGG COMPOUND |
| chlorimuron | Alan Wood's Pesticides |
| Registry Numbers | Sources |
|---|---|
| Reaxys:7779120 | Reaxys |
| CAS:99283-00-8 | ChemIDplus |
| CAS:99283-00-8 | KEGG COMPOUND |
| CAS:99283-00-8 | Alan Wood's Pesticides |