EMBL-EBI | Chemical Biology Resources | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C2H3BrO2 |
| Net Charge | 0 |
| Average Mass | 138.948 |
| Monoisotopic Mass | 137.93164 |
| SMILES | O=C(O)CBr |
| InChI | InChI=1S/C2H3BrO2/c3-1-2(4)5/h1H2,(H,4,5) |
| InChIKey | KDPAWGWELVVRCH-UHFFFAOYSA-N |
| Wikipedia |
|---|
| Roles Classification |
|---|
| Chemical Role: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| Biological Roles: | alkylating agent Highly reactive chemical that introduces alkyl radicals into biologically active molecules and thereby prevents their proper functioning. It could be used as an antineoplastic agent, but it might be very toxic, with carcinogenic, mutagenic, teratogenic, and immunosuppressant actions. It could also be used as a component of poison gases. teratogenic agent A role played by a chemical compound in biological systems with adverse consequences in embryo developments, leading to birth defects, embryo death or altered development, growth retardation and functional defect. nephrotoxic agent A role played by any chemical compound (natural or synthetic) exhibiting itself through the ability to induce damage to the kidneys. cardiotoxic agent A role played by a chemical compound exhibiting itself through the ability to induce damage to the heart and cardiomyocytes. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| bromoacetic acid (CHEBI:47264) has role alkylating agent (CHEBI:22333) |
| bromoacetic acid (CHEBI:47264) has role cardiotoxic agent (CHEBI:50912) |
| bromoacetic acid (CHEBI:47264) has role nephrotoxic agent (CHEBI:50909) |
| bromoacetic acid (CHEBI:47264) has role teratogenic agent (CHEBI:50905) |
| bromoacetic acid (CHEBI:47264) is a 2-bromocarboxylic acid (CHEBI:134367) |
| bromoacetic acid (CHEBI:47264) is a haloacetic acid (CHEBI:16277) |
| bromoacetic acid (CHEBI:47264) is conjugate acid of bromoacetate (CHEBI:192408) |
| Incoming Relation(s) |
| bromoacetate (CHEBI:192408) is conjugate base of bromoacetic acid (CHEBI:47264) |
| IUPAC Name |
|---|
| bromoacetic acid |
| Synonyms | Source |
|---|---|
| 2-bromoacetic acid | CAS |
| 2-bromoethanoic acid | CAS |
| BAA | ChEBI |
| bromoethanoic acid | CAS |
| carboxymethyl bromide | CAS |
| MBAA | CAS |
| Manual Xrefs | Databases |
|---|---|
| 10301338 | ChemSpider |
| Bromoacetic_acid | Wikipedia |
| BXA | PDBeChem |
| DB02198 | DrugBank |
| LMFA01090074 | LIPID MAPS |
| Registry Numbers | Sources |
|---|---|
| Reaxys:506167 | Reaxys |
| CAS:79-08-3 | CAS |
| Citations |
|---|