EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
CHEBI:192408 - bromoacetate
| Formula | C2H2BrO2 |
| Net Charge | -1 |
| Average Mass | 137.940 |
| Monoisotopic Mass | 136.92436 |
| SMILES | O=C([O-])CBr |
| InChI | InChI=1S/C2H3BrO2/c3-1-2(4)5/h1H2,(H,4,5)/p-1 |
| InChIKey | KDPAWGWELVVRCH-UHFFFAOYSA-M |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Pinus radiata (ncbitaxon:3347) | leaf (BTO:0000713) | MetaboLights (MTBLS4567) |
| Roles Classification |
|---|
| Chemical Role: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| bromoacetate (CHEBI:192408) is a carboxylic acid (CHEBI:33575) |
| bromoacetate (CHEBI:192408) is a organohalogen compound (CHEBI:17792) |
| IUPAC Name |
|---|
| 2-bromoacetate |