EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C28H36O13 |
| Net Charge | 0 |
| Average Mass | 580.583 |
| Monoisotopic Mass | 580.21559 |
| SMILES | [H][C@]12CO[C@H](c3cc(OC)c(O[C@@H]4O[C@H](CO)[C@@H](O)[C@H](O)[C@H]4O)c(OC)c3)[C@@]1([H])CO[C@@H]2c1cc(OC)c(O)c(OC)c1 |
| InChI | InChI=1S/C28H36O13/c1-34-16-5-12(6-17(35-2)21(16)30)25-14-10-39-26(15(14)11-38-25)13-7-18(36-3)27(19(8-13)37-4)41-28-24(33)23(32)22(31)20(9-29)40-28/h5-8,14-15,20,22-26,28-33H,9-11H2,1-4H3/t14-,15-,20+,22+,23-,24+,25+,26+,28-/m0/s1 |
| InChIKey | WEKCEGQSIIQPAQ-IRBNZIFYSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Acer saccharum (ncbitaxon:4024) | bark (BTO:0001301) | PubMed (22032697) | The air-dried powder of the bark was extracted by maceration with methanol |
| Roles Classification |
|---|
| Biological Role: | metabolite Any intermediate or product resulting from metabolism. The term 'metabolite' subsumes the classes commonly known as primary and secondary metabolites. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| (+)-syringaresinol β-D-glucoside (CHEBI:28603) has functional parent (+)-syringaresinol (CHEBI:47) |
| (+)-syringaresinol β-D-glucoside (CHEBI:28603) has role metabolite (CHEBI:25212) |
| (+)-syringaresinol β-D-glucoside (CHEBI:28603) is a β-D-glucoside (CHEBI:22798) |
| IUPAC Name |
|---|
| (7α,7'α,8α,8'α)-4'-(β-D-glucopyranosyloxy)-3,3',5,5'-tetramethoxy-7,9':7',9-diepoxylignan-4-ol |
| Synonyms | Source |
|---|---|
| (+)-Syringaresinol O-beta-D-glucoside | KEGG COMPOUND |
| Acanthoside B | KEGG COMPOUND |