EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
CHEBI:46958 - vanillylamine
| Formula | C8H11NO2 |
| Net Charge | 0 |
| Average Mass | 153.181 |
| Monoisotopic Mass | 153.07898 |
| SMILES | COc1cc(CN)ccc1O |
| InChI | InChI=1S/C8H11NO2/c1-11-8-4-6(5-9)2-3-7(8)10/h2-4,10H,5,9H2,1H3 |
| InChIKey | WRPWWVNUCXQDQV-UHFFFAOYSA-N |
| Roles Classification |
|---|
| Chemical Role: | Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| vanillylamine (CHEBI:46958) has functional parent vanillyl alcohol (CHEBI:18353) |
| vanillylamine (CHEBI:46958) is a aralkylamino compound (CHEBI:64365) |
| vanillylamine (CHEBI:46958) is conjugate base of vanillylamine(1+) (CHEBI:149596) |
| Incoming Relation(s) |
| vanillylamine(1+) (CHEBI:149596) is conjugate acid of vanillylamine (CHEBI:46958) |
| IUPAC Name |
|---|
| 4-(aminomethyl)-2-methoxyphenol |
| Synonym | Source |
|---|---|
| 4-hydroxy-3-methoxybenzylamine | ChEBI |
| Citations |
|---|