EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C8H10O3 |
| Net Charge | 0 |
| Average Mass | 154.165 |
| Monoisotopic Mass | 154.06299 |
| SMILES | COc1cc(CO)ccc1O |
| InChI | InChI=1S/C8H10O3/c1-11-8-4-6(5-9)2-3-7(8)10/h2-4,9-10H,5H2,1H3 |
| InChIKey | ZENOXNGFMSCLLL-UHFFFAOYSA-N |
| Wikipedia |
|---|
| Roles Classification |
|---|
| Biological Role: | plant metabolite Any eukaryotic metabolite produced during a metabolic reaction in plants, the kingdom that include flowering plants, conifers and other gymnosperms. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| vanillyl alcohol (CHEBI:18353) has role plant metabolite (CHEBI:76924) |
| vanillyl alcohol (CHEBI:18353) is a benzyl alcohols (CHEBI:22743) |
| vanillyl alcohol (CHEBI:18353) is a guaiacols (CHEBI:134251) |
| Incoming Relation(s) |
| capsiate (CHEBI:134190) has functional parent vanillyl alcohol (CHEBI:18353) |
| vanillyl alcohol diacetate (CHEBI:86957) has functional parent vanillyl alcohol (CHEBI:18353) |
| vanillyl alcohol monosulfate (CHEBI:133583) has functional parent vanillyl alcohol (CHEBI:18353) |
| vanillyl β-D-glucopyranoside (CHEBI:86958) has functional parent vanillyl alcohol (CHEBI:18353) |
| vanillylamine (CHEBI:46958) has functional parent vanillyl alcohol (CHEBI:18353) |
| IUPAC Name |
|---|
| 4-(hydroxymethyl)-2-methoxyphenol |
| Synonyms | Source |
|---|---|
| 4-hydroxy-3-methoxy-benzenemethanol | ChEBI |
| 4-hydroxy-3-methoxybenzenemethanol | ChEBI |
| 4-Hydroxy-3-methoxy-benzenemethanol | KEGG COMPOUND |
| 4-Hydroxy-3-methoxybenzenemethanol | KEGG COMPOUND |
| 4-hydroxy-3-methoxybenzyl alcohol | ChEBI |
| 4-Hydroxy-3-methoxybenzyl alcohol | KEGG COMPOUND |
| UniProt Name | Source |
|---|---|
| 4-hydroxy-3-methoxy-benzenemethanol | UniProt |
| Manual Xrefs | Databases |
|---|---|
| c0588 | UM-BBD |
| C06317 | KEGG COMPOUND |
| C06317 | KEGG COMPOUND |
| HMDB0032012 | HMDB |
| Vanillyl_alcohol | Wikipedia |
| Registry Numbers | Sources |
|---|---|
| Reaxys:1910044 | Reaxys |
| CAS:498-00-0 | KEGG COMPOUND |
| Citations |
|---|