EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C8H12NO2 |
| Net Charge | +1 |
| Average Mass | 154.189 |
| Monoisotopic Mass | 154.08626 |
| SMILES | COc1cc(C[NH3+])ccc1O |
| InChI | InChI=1S/C8H11NO2/c1-11-8-4-6(5-9)2-3-7(8)10/h2-4,10H,5,9H2,1H3/p+1 |
| InChIKey | WRPWWVNUCXQDQV-UHFFFAOYSA-O |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| vanillylamine(1+) (CHEBI:149596) is a arylmethylammonium (CHEBI:87910) |
| vanillylamine(1+) (CHEBI:149596) is conjugate acid of vanillylamine (CHEBI:46958) |
| Incoming Relation(s) |
| vanillylamine (CHEBI:46958) is conjugate base of vanillylamine(1+) (CHEBI:149596) |
| IUPAC Name |
|---|
| (4-hydroxy-3-methoxyphenyl)methanaminium |
| UniProt Name | Source |
|---|---|
| vanillylamine | UniProt |
| Manual Xrefs | Databases |
|---|---|
| CPD-9327 | MetaCyc |