EMBL-EBI | Chemical Biology Resources | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C19H19N2O4 |
| Net Charge | -1 |
| Average Mass | 339.371 |
| Monoisotopic Mass | 339.13503 |
| SMILES | O=C(NCCC[C@H](NC(=O)c1ccccc1)C(=O)[O-])c1ccccc1 |
| InChI | InChI=1S/C19H20N2O4/c22-17(14-8-3-1-4-9-14)20-13-7-12-16(19(24)25)21-18(23)15-10-5-2-6-11-15/h1-6,8-11,16H,7,12-13H2,(H,20,22)(H,21,23)(H,24,25)/p-1/t16-/m0/s1 |
| InChIKey | NTRBNFOLBJWRAO-INIZCTEOSA-M |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| N2,N5-dibenzoyl-L-ornithinate (CHEBI:57722) has functional parent L-ornithinate (CHEBI:46914) |
| N2,N5-dibenzoyl-L-ornithinate (CHEBI:57722) is a N-acyl-L-α-amino acid anion (CHEBI:59874) |
| N2,N5-dibenzoyl-L-ornithinate (CHEBI:57722) is conjugate base of N2,N5-diacyl-L-ornithine (CHEBI:21806) |
| Incoming Relation(s) |
| N2,N5-diacyl-L-ornithine (CHEBI:21806) is conjugate acid of N2,N5-dibenzoyl-L-ornithinate (CHEBI:57722) |
| IUPAC Names |
|---|
| (2S)-2,5-bis(benzoylamino)pentanoate |
| N2,N5-dibenzoyl-L-ornithinate |
| Synonym | Source |
|---|---|
| N2,N5-dibenzoyl-L-ornithinate anion | ChEBI |
| UniProt Name | Source |
|---|---|
| N2,N5-dibenzoyl-L-ornithine | UniProt |
| Registry Numbers | Sources |
|---|---|
| Beilstein:6096662 | Beilstein |