EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C5H11N2O2 |
| Net Charge | -1 |
| Average Mass | 131.155 |
| Monoisotopic Mass | 131.08260 |
| SMILES | NCCCC(N)C(=O)[O-] |
| InChI | InChI=1S/C5H12N2O2/c6-3-1-2-4(7)5(8)9/h4H,1-3,6-7H2,(H,8,9)/p-1 |
| InChIKey | AHLPHDHHMVZTML-UHFFFAOYSA-M |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| ornithinate (CHEBI:32964) has functional parent valerate (CHEBI:31011) |
| ornithinate (CHEBI:32964) is a α-amino-acid anion (CHEBI:33558) |
| ornithinate (CHEBI:32964) is conjugate base of ornithine (CHEBI:18257) |
| Incoming Relation(s) |
| L-ornithinate (CHEBI:46914) is a ornithinate (CHEBI:32964) |
| ornithine (CHEBI:18257) is conjugate acid of ornithinate (CHEBI:32964) |
| IUPAC Names |
|---|
| 2,5-diaminopentanoate |
| ornithinate |
| Synonym | Source |
|---|---|
| ornithine anion | JCBN |
| Registry Numbers | Sources |
|---|---|
| Gmelin:1242186 | Gmelin |