EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C12H22O4 |
| Net Charge | 0 |
| Average Mass | 230.304 |
| Monoisotopic Mass | 230.15181 |
| SMILES | O=C(O)CCCCCCCCCCC(=O)O |
| InChI | InChI=1S/C12H22O4/c13-11(14)9-7-5-3-1-2-4-6-8-10-12(15)16/h1-10H2,(H,13,14)(H,15,16) |
| InChIKey | TVIDDXQYHWJXFK-UHFFFAOYSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Homo sapiens (ncbitaxon:9606) | |||
| - | PubMed (9591306) | ||
| blood serum (BTO:0000133) | MetaboLights (MTBLS90) |
| Roles Classification |
|---|
| Chemical Role: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| Biological Roles: | EC 1.1.1.1 (alcohol dehydrogenase) inhibitor An EC 1.1.1.* (oxidoreductase acting on donor CH-OH group, NAD+ or NADP+ acceptor) inhibitor that interferes with the action of alcohol dehydrogenase (EC 1.1.1.1). human metabolite Any mammalian metabolite produced during a metabolic reaction in humans (Homo sapiens). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| dodecanedioic acid (CHEBI:4676) has parent hydride dodecane (CHEBI:28817) |
| dodecanedioic acid (CHEBI:4676) has role EC 1.1.1.1 (alcohol dehydrogenase) inhibitor (CHEBI:50269) |
| dodecanedioic acid (CHEBI:4676) has role human metabolite (CHEBI:77746) |
| dodecanedioic acid (CHEBI:4676) is a dicarboxylic fatty acid (CHEBI:189840) |
| dodecanedioic acid (CHEBI:4676) is a α,ω-dicarboxylic acid (CHEBI:28383) |
| dodecanedioic acid (CHEBI:4676) is conjugate acid of dodecanedioate(2−) (CHEBI:76273) |
| Incoming Relation(s) |
| O-dodecanedioylcarnitine (CHEBI:74121) has functional parent dodecanedioic acid (CHEBI:4676) |
| 1,12-di-L-ascorbyl dodecanedioate (CHEBI:59753) has functional parent dodecanedioic acid (CHEBI:4676) |
| dodecanedioyl-CoA (CHEBI:76339) has functional parent dodecanedioic acid (CHEBI:4676) |
| dodecanedioate(2−) (CHEBI:76273) is conjugate base of dodecanedioic acid (CHEBI:4676) |
| IUPAC Name |
|---|
| dodecanedioic acid |
| Synonyms | Source |
|---|---|
| Dodecanedioic acid | KEGG COMPOUND |
| decamethylenedicarboxylic acid | NIST Chemistry WebBook |
| 1,10-decanedicarboxylic acid | ChemIDplus |
| 1,12-dodecanedioic acid | NIST Chemistry WebBook |
| 1,10-dicarboxydecane | ChemIDplus |
| Manual Xrefs | Databases |
|---|---|
| C02678 | KEGG COMPOUND |
| LMFA01170009 | LIPID MAPS |
| HMDB0000623 | HMDB |
| CPD-10670 | MetaCyc |
| EP2407444 | Patent |
| WO2010085712 | Patent |
| EP2389349 | Patent |
| KR20110125221 | Patent |
| DE102007054497 | Patent |
| Citations |
|---|