EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C24H34O14 |
| Net Charge | 0 |
| Average Mass | 546.522 |
| Monoisotopic Mass | 546.19486 |
| SMILES | [H][C@]1([C@@H](O)COC(=O)CCCCCCCCCCC(=O)OC[C@H](O)[C@@]2([H])OC(=O)C(O)=C2O)OC(=O)C(O)=C1O |
| InChI | InChI=1S/C24H34O14/c25-13(21-17(29)19(31)23(33)37-21)11-35-15(27)9-7-5-3-1-2-4-6-8-10-16(28)36-12-14(26)22-18(30)20(32)24(34)38-22/h13-14,21-22,25-26,29-32H,1-12H2/t13-,14-,21+,22+/m0/s1 |
| InChIKey | JWKHXZXIDRXHAT-HCIHMXRSSA-N |
| Roles Classification |
|---|
| Chemical Role: | bolaamphiphile A surfactant molecule with hydrophilic groups at both ends of a hydrophobic hydrocarbon chain |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 1,12-di-L-ascorbyl dodecanedioate (CHEBI:59753) has functional parent L-ascorbic acid (CHEBI:29073) |
| 1,12-di-L-ascorbyl dodecanedioate (CHEBI:59753) has functional parent dodecanedioic acid (CHEBI:4676) |
| 1,12-di-L-ascorbyl dodecanedioate (CHEBI:59753) has role bolaamphiphile (CHEBI:59752) |
| 1,12-di-L-ascorbyl dodecanedioate (CHEBI:59753) is a dicarboxylic acids and O-substituted derivatives (CHEBI:131927) |
| 1,12-di-L-ascorbyl dodecanedioate (CHEBI:59753) is a diester (CHEBI:51307) |
| IUPAC Name |
|---|
| bis{(2S)-2-[(2R)-3,4-dihydroxy-5-oxo-2,5-dihydrofuran-2-yl]-2-hydroxyethyl} dodecanedioate |
| Synonyms | Source |
|---|---|
| 1,12-diascorbyl dodecanedioate | ChEBI |
| BOLA12 | ChEBI |
| Registry Numbers | Sources |
|---|---|
| Beilstein:10407678 | Beilstein |
| Citations |
|---|