EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C12H20O4 |
| Net Charge | -2 |
| Average Mass | 228.288 |
| Monoisotopic Mass | 228.13726 |
| SMILES | O=C([O-])CCCCCCCCCCC(=O)[O-] |
| InChI | InChI=1S/C12H22O4/c13-11(14)9-7-5-3-1-2-4-6-8-10-12(15)16/h1-10H2,(H,13,14)(H,15,16)/p-2 |
| InChIKey | TVIDDXQYHWJXFK-UHFFFAOYSA-L |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Homo sapiens (ncbitaxon:9606) | - | PubMed (21886157) |
| Roles Classification |
|---|
| Biological Role: | human metabolite Any mammalian metabolite produced during a metabolic reaction in humans (Homo sapiens). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| dodecanedioate(2−) (CHEBI:76273) has role human metabolite (CHEBI:77746) |
| dodecanedioate(2−) (CHEBI:76273) is a saturated dicarboxylic acid dianion(2−) (CHEBI:133291) |
| dodecanedioate(2−) (CHEBI:76273) is conjugate base of dodecanedioic acid (CHEBI:4676) |
| Incoming Relation(s) |
| dodecanedioic acid (CHEBI:4676) is conjugate acid of dodecanedioate(2−) (CHEBI:76273) |
| IUPAC Name |
|---|
| dodecanedioate |
| Synonym | Source |
|---|---|
| C12-DCA(2−) | SUBMITTER |
| UniProt Name | Source |
|---|---|
| dodecanedioate | UniProt |
| Manual Xrefs | Databases |
|---|---|
| CPD-10670 | MetaCyc |
| Registry Numbers | Sources |
|---|---|
| Reaxys:4313813 | Reaxys |
| Citations |
|---|