EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C8H16O |
| Net Charge | 0 |
| Average Mass | 128.215 |
| Monoisotopic Mass | 128.12012 |
| SMILES | C=C[C@@H](O)CCCCC |
| InChI | InChI=1S/C8H16O/c1-3-5-6-7-8(9)4-2/h4,8-9H,2-3,5-7H2,1H3/t8-/m1/s1 |
| InChIKey | VSMOENVRRABVKN-MRVPVSSYSA-N |
| Roles Classification |
|---|
| Biological Roles: | antimicrobial agent A substance that kills or slows the growth of microorganisms, including bacteria, viruses, fungi and protozoans. volatile oil component Any plant metabolite that is found naturally as a component of a volatile oil. insect attractant A chemical that attracts insects. fungal metabolite Any eukaryotic metabolite produced during a metabolic reaction in fungi, the kingdom that includes microorganisms such as the yeasts and moulds. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| (S)-oct-1-en-3-ol (CHEBI:46735) is a oct-1-en-3-ol (CHEBI:34118) |
| (S)-oct-1-en-3-ol (CHEBI:46735) is enantiomer of (R)-oct-1-en-3-ol (CHEBI:39932) |
| Incoming Relation(s) |
| (R)-oct-1-en-3-ol (CHEBI:39932) is enantiomer of (S)-oct-1-en-3-ol (CHEBI:46735) |
| IUPAC Name |
|---|
| (3S)-oct-1-en-3-ol |
| Synonyms | Source |
|---|---|
| (+)-1-octen-3-ol | ChemIDplus |
| (3S)-1-octen-3-ol | ChemIDplus |
| (S)-(+)-1-octen-3-ol | ChemIDplus |
| (S)-1-octen-3-ol | ChemIDplus |
| (S)-matsutake alcohol | ChemIDplus |
| Registry Numbers | Sources |
|---|---|
| Reaxys:1720731 | Reaxys |
| CAS:24587-53-9 | ChemIDplus |
| Citations |
|---|