EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C8H16O |
| Net Charge | 0 |
| Average Mass | 128.215 |
| Monoisotopic Mass | 128.12012 |
| SMILES | C=CC(O)CCCCC |
| InChI | InChI=1S/C8H16O/c1-3-5-6-7-8(9)4-2/h4,8-9H,2-3,5-7H2,1H3 |
| InChIKey | VSMOENVRRABVKN-UHFFFAOYSA-N |
| Wikipedia |
|---|
| Roles Classification |
|---|
| Biological Roles: | insect attractant A chemical that attracts insects. volatile oil component Any plant metabolite that is found naturally as a component of a volatile oil. fungal metabolite Any eukaryotic metabolite produced during a metabolic reaction in fungi, the kingdom that includes microorganisms such as the yeasts and moulds. antimicrobial agent A substance that kills or slows the growth of microorganisms, including bacteria, viruses, fungi and protozoans. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| oct-1-en-3-ol (CHEBI:34118) has parent hydride 1-octene (CHEBI:46708) |
| oct-1-en-3-ol (CHEBI:34118) has role antimicrobial agent (CHEBI:33281) |
| oct-1-en-3-ol (CHEBI:34118) has role fungal metabolite (CHEBI:76946) |
| oct-1-en-3-ol (CHEBI:34118) has role insect attractant (CHEBI:24850) |
| oct-1-en-3-ol (CHEBI:34118) has role volatile oil component (CHEBI:27311) |
| oct-1-en-3-ol (CHEBI:34118) is a alkenyl alcohol (CHEBI:50582) |
| oct-1-en-3-ol (CHEBI:34118) is a medium-chain fatty alcohol (CHEBI:197506) |
| Incoming Relation(s) |
| (R)-oct-1-en-3-ol (CHEBI:39932) is a oct-1-en-3-ol (CHEBI:34118) |
| (S)-oct-1-en-3-ol (CHEBI:46735) is a oct-1-en-3-ol (CHEBI:34118) |
| IUPAC Name |
|---|
| oct-1-en-3-ol |
| Synonyms | Source |
|---|---|
| 1-octen-3-ol | KEGG COMPOUND |
| 1-vinylhexanol | ChemIDplus |
| 3-hydroxy-1-octene | NIST Chemistry WebBook |
| 3-octenol | ChemIDplus |
| amylvinylcarbinol | ChemIDplus |
| matsutake alcohol | ChemIDplus |
| Manual Xrefs | Databases |
|---|---|
| 1-Octen-3-ol | Wikipedia |
| 2063 | BPDB |
| C00029423 | KNApSAcK |
| C14272 | KEGG COMPOUND |
| LMFA05000090 | LIPID MAPS |
| Citations |
|---|