EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C8H16O |
| Net Charge | 0 |
| Average Mass | 128.215 |
| Monoisotopic Mass | 128.12012 |
| SMILES | C=C[C@H](O)CCCCC |
| InChI | InChI=1S/C8H16O/c1-3-5-6-7-8(9)4-2/h4,8-9H,2-3,5-7H2,1H3/t8-/m0/s1 |
| InChIKey | VSMOENVRRABVKN-QMMMGPOBSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Agaricus bisporus (ncbitaxon:5341) | - | DOI (10.1016/j.foodchem.2003.08.016) | |
| Hericium erinaceus (ncbitaxon:91752) | - | DOI (10.1016/j.foodchem.2003.08.016) | Species also known as Hericium erinaceum. |
| Lentinula edodes (ncbitaxon:5353) | - | DOI (10.1016/j.foodchem.2003.08.016) | |
| Pleurotus ostreatus (ncbitaxon:5322) | - | DOI (10.1016/j.foodchem.2003.08.016) | |
| Boletus edulis (ncbitaxon:36056) | - | DOI (10.1016/j.foodchem.2003.08.016) | |
| Xerocomus badius (ncbitaxon:36058) | - | DOI (10.1016/j.foodchem.2003.08.016) | |
| Macrolepiota procera (ncbitaxon:56183) | - | DOI (10.1016/j.foodchem.2003.08.016) | |
| Tricholoma matsutake (ncbitaxon:40145) | - | PubMed (32120462) |
| Roles Classification |
|---|
| Biological Roles: | insect attractant A chemical that attracts insects. flavouring agent A food additive that is used to added improve the taste or odour of a food. insect attractant A chemical that attracts insects. volatile oil component Any plant metabolite that is found naturally as a component of a volatile oil. fungal metabolite Any eukaryotic metabolite produced during a metabolic reaction in fungi, the kingdom that includes microorganisms such as the yeasts and moulds. antimicrobial agent A substance that kills or slows the growth of microorganisms, including bacteria, viruses, fungi and protozoans. |
| Application: | flavouring agent A food additive that is used to added improve the taste or odour of a food. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| (R)-oct-1-en-3-ol (CHEBI:39932) has role flavouring agent (CHEBI:35617) |
| (R)-oct-1-en-3-ol (CHEBI:39932) has role insect attractant (CHEBI:24850) |
| (R)-oct-1-en-3-ol (CHEBI:39932) is a oct-1-en-3-ol (CHEBI:34118) |
| (R)-oct-1-en-3-ol (CHEBI:39932) is enantiomer of (S)-oct-1-en-3-ol (CHEBI:46735) |
| Incoming Relation(s) |
| (S)-oct-1-en-3-ol (CHEBI:46735) is enantiomer of (R)-oct-1-en-3-ol (CHEBI:39932) |
| IUPAC Name |
|---|
| (3R)-oct-1-en-3-ol |
| Synonyms | Source |
|---|---|
| (R)-1-octen-3-ol | ChEBI |
| (R)-oct-1-en-3-ol | LIPID MAPS |
| (3R)-1-octen-3-ol | ChEBI |
| (R)-(−)-oct-1-en-3-ol | ChEBI |
| (3R)-(−)-oct-1-en-3-ol | ChEBI |
| (R)-(−)-1-octen-3-ol | ChEBI |
| Manual Xrefs | Databases |
|---|---|
| 3OL | PDBeChem |
| LMFA05000093 | LIPID MAPS |
| 5360388 | ChemSpider |
| HMDB0031299 | HMDB |
| FDB003350 | FooDB |
| Registry Numbers | Sources |
|---|---|
| Reaxys:1720732 | Reaxys |
| CAS:3687-48-7 | ChEBI |
| Citations |
|---|