EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C8H15O2.C8H16O2.Na |
| Net Charge | 0 |
| Average Mass | 310.410 |
| Monoisotopic Mass | 310.21200 |
| SMILES | CCCC(CCC)C(=O)O.CCCC(CCC)C(=O)[O-].[Na+] |
| InChI | InChI=1S/2C8H16O2.Na/c2*1-3-5-7(6-4-2)8(9)10;/h2*7H,3-6H2,1-2H3,(H,9,10);/q;;+1/p-1 |
| InChIKey | MSRILKIQRXUYCT-UHFFFAOYSA-M |
| Roles Classification |
|---|
| Biological Role: | GABA agent A substance, such as agonists, antagonists, degradation or uptake inhibitors, depleters, precursors, and modulators of receptor function, used for its pharmacological actions on GABAergic systems. |
| Applications: | anticonvulsant A drug used to prevent seizures or reduce their severity. antimanic drug Antimanic drugs are agents used to treat bipolar disorders or mania associated with other affective disorders. GABA agent A substance, such as agonists, antagonists, degradation or uptake inhibitors, depleters, precursors, and modulators of receptor function, used for its pharmacological actions on GABAergic systems. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| valproate semisodium (CHEBI:4667) has part sodium valproate (CHEBI:9925) |
| valproate semisodium (CHEBI:4667) has part valproic acid (CHEBI:39867) |
| valproate semisodium (CHEBI:4667) has role anticonvulsant (CHEBI:35623) |
| valproate semisodium (CHEBI:4667) has role antimanic drug (CHEBI:35477) |
| valproate semisodium (CHEBI:4667) has role GABA agent (CHEBI:51374) |
| valproate semisodium (CHEBI:4667) is a organic sodium salt (CHEBI:38700) |
| IUPAC Name |
|---|
| sodium 2-propylpentanoate—2-propylpentanoic acid (1:1) |
| INNs | Source |
|---|---|
| valproate semisodique | ChemIDplus |
| valproate semisodium | ChEBI |
| valproato semisodico | ChemIDplus |
| valproatum seminatricum | ChemIDplus |
| Synonyms | Source |
|---|---|
| divalproex sodium | ChemIDplus |
| semisodium valproate | ChEBI |
| sodium divalproate | ChemIDplus |
| sodium hydrogen bis(2-propylpentanoate) | ChemIDplus |
| sodium hydrogen bis(2-propylvalerate) | ChemIDplus |
| sodium hydrogen divalproate | ChemIDplus |
| Registry Numbers | Sources |
|---|---|
| Beilstein:8462424 | Beilstein |
| CAS:76584-70-8 | KEGG DRUG |
| CAS:76584-70-8 | ChemIDplus |