EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C8H15O2.C8H16O2.Na |
| Net Charge | 0 |
| Average Mass | 310.410 |
| Monoisotopic Mass | 310.21200 |
| SMILES | CCCC(CCC)C(=O)O.CCCC(CCC)C(=O)[O-].[Na+] |
| InChI | InChI=1S/2C8H16O2.Na/c2*1-3-5-7(6-4-2)8(9)10;/h2*7H,3-6H2,1-2H3,(H,9,10);/q;;+1/p-1 |
| InChIKey | MSRILKIQRXUYCT-UHFFFAOYSA-M |
| Roles Classification |
|---|
| Biological Role: | GABA agent A substance, such as agonists, antagonists, degradation or uptake inhibitors, depleters, precursors, and modulators of receptor function, used for its pharmacological actions on GABAergic systems. |
| Applications: | anticonvulsant A drug used to prevent seizures or reduce their severity. GABA agent A substance, such as agonists, antagonists, degradation or uptake inhibitors, depleters, precursors, and modulators of receptor function, used for its pharmacological actions on GABAergic systems. antimanic drug Antimanic drugs are agents used to treat bipolar disorders or mania associated with other affective disorders. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| valproate semisodium (CHEBI:4667) has part sodium valproate (CHEBI:9925) |
| valproate semisodium (CHEBI:4667) has part valproic acid (CHEBI:39867) |
| valproate semisodium (CHEBI:4667) has role anticonvulsant (CHEBI:35623) |
| valproate semisodium (CHEBI:4667) has role antimanic drug (CHEBI:35477) |
| valproate semisodium (CHEBI:4667) has role GABA agent (CHEBI:51374) |
| valproate semisodium (CHEBI:4667) is a organic sodium salt (CHEBI:38700) |
| IUPAC Name |
|---|
| sodium 2-propylpentanoate—2-propylpentanoic acid (1:1) |
| INNs | Source |
|---|---|
| valproatum seminatricum | ChemIDplus |
| valproato semisodico | ChemIDplus |
| valproate semisodium | ChEBI |
| valproate semisodique | ChemIDplus |
| Synonyms | Source |
|---|---|
| divalproex sodium | ChemIDplus |
| sodium hydrogen bis(2-propylpentanoate) | ChemIDplus |
| sodium hydrogen divalproate | ChemIDplus |
| sodium divalproate | ChemIDplus |
| sodium hydrogen bis(2-propylvalerate) | ChemIDplus |
| semisodium valproate | ChEBI |
| Registry Numbers | Sources |
|---|---|
| Beilstein:8462424 | Beilstein |
| CAS:76584-70-8 | KEGG DRUG |
| CAS:76584-70-8 | ChemIDplus |