EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C8H15O2.C8H16O2.Na |
| Net Charge | 0 |
| Average Mass | 310.410 |
| Monoisotopic Mass | 310.21200 |
| SMILES | CCCC(CCC)C(=O)O.CCCC(CCC)C(=O)[O-].[Na+] |
| InChI | InChI=1S/2C8H16O2.Na/c2*1-3-5-7(6-4-2)8(9)10;/h2*7H,3-6H2,1-2H3,(H,9,10);/q;;+1/p-1 |
| InChIKey | MSRILKIQRXUYCT-UHFFFAOYSA-M |
| Roles Classification |
|---|
| Biological Role: | GABA agent A substance, such as agonists, antagonists, degradation or uptake inhibitors, depleters, precursors, and modulators of receptor function, used for its pharmacological actions on GABAergic systems. |
| Applications: | antimanic drug Antimanic drugs are agents used to treat bipolar disorders or mania associated with other affective disorders. antineoplastic agent A substance that inhibits or prevents the proliferation of neoplasms. antidepressant Antidepressants are mood-stimulating drugs used primarily in the treatment of affective disorders and related conditions. antipsychotic agent Antipsychotic drugs are agents that control agitated psychotic behaviour, alleviate acute psychotic states, reduce psychotic symptoms, and exert a quieting effect. anticonvulsant A drug used to prevent seizures or reduce their severity. GABA agent A substance, such as agonists, antagonists, degradation or uptake inhibitors, depleters, precursors, and modulators of receptor function, used for its pharmacological actions on GABAergic systems. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| valproate semisodium (CHEBI:4667) has part sodium valproate (CHEBI:9925) |
| valproate semisodium (CHEBI:4667) has part valproic acid (CHEBI:39867) |
| valproate semisodium (CHEBI:4667) has role anticonvulsant (CHEBI:35623) |
| valproate semisodium (CHEBI:4667) has role antidepressant (CHEBI:35469) |
| valproate semisodium (CHEBI:4667) has role antimanic drug (CHEBI:35477) |
| valproate semisodium (CHEBI:4667) has role antineoplastic agent (CHEBI:35610) |
| valproate semisodium (CHEBI:4667) has role antipsychotic agent (CHEBI:35476) |
| valproate semisodium (CHEBI:4667) has role GABA agent (CHEBI:51374) |
| valproate semisodium (CHEBI:4667) is a organic sodium salt (CHEBI:38700) |
| IUPAC Name |
|---|
| sodium 2-propylpentanoate—2-propylpentanoic acid (1:1) |
| INNs | Source |
|---|---|
| valproate semisodique | ChemIDplus |
| valproate semisodium | ChEBI |
| valproato semisodico | ChemIDplus |
| valproatum seminatricum | ChemIDplus |
| Synonyms | Source |
|---|---|
| ABBOTT 50711 | ChEMBL |
| ABBOTT-50711 | ChEMBL |
| divalproex sodium | ChEMBL |
| divalproex sodium | ChemIDplus |
| semisodium valproate | ChEBI |
| sodium divalproate | ChemIDplus |
| Brand Names | Source |
|---|---|
| Depakote cp | ChEMBL |
| Depakote er | ChEMBL |
| Registry Numbers | Sources |
|---|---|
| Beilstein:8462424 | Beilstein |
| CAS:76584-70-8 | KEGG DRUG |
| CAS:76584-70-8 | ChemIDplus |
| Citations |
|---|