EMBL-EBI | Chemical Biology Resources | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C8H15O2.Na |
| Net Charge | 0 |
| Average Mass | 166.196 |
| Monoisotopic Mass | 166.09697 |
| SMILES | CCCC(CCC)C(=O)[O-].[Na+] |
| InChI | InChI=1S/C8H16O2.Na/c1-3-5-7(6-4-2)8(9)10;/h7H,3-6H2,1-2H3,(H,9,10);/q;+1/p-1 |
| InChIKey | AEQFSUDEHCCHBT-UHFFFAOYSA-M |
| Roles Classification |
|---|
| Biological Role: | EC 3.5.1.98 (histone deacetylase) inhibitor An EC 3.5.1.* (non-peptide linear amide C-N hydrolase) inhibitor that interferes with the function of histone deacetylase (EC 3.5.1.98). |
| Applications: | geroprotector Any compound that supports healthy aging, slows the biological aging process, or extends lifespan. antipsychotic agent Antipsychotic drugs are agents that control agitated psychotic behaviour, alleviate acute psychotic states, reduce psychotic symptoms, and exert a quieting effect. anticonvulsant A drug used to prevent seizures or reduce their severity. antineoplastic agent A substance that inhibits or prevents the proliferation of neoplasms. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| sodium valproate (CHEBI:9925) has part valproate (CHEBI:60654) |
| sodium valproate (CHEBI:9925) has role anticonvulsant (CHEBI:35623) |
| sodium valproate (CHEBI:9925) has role antineoplastic agent (CHEBI:35610) |
| sodium valproate (CHEBI:9925) has role antipsychotic agent (CHEBI:35476) |
| sodium valproate (CHEBI:9925) has role EC 3.5.1.98 (histone deacetylase) inhibitor (CHEBI:61115) |
| sodium valproate (CHEBI:9925) has role geroprotector (CHEBI:176497) |
| sodium valproate (CHEBI:9925) is a organic sodium salt (CHEBI:38700) |
| Incoming Relation(s) |
| valproate semisodium (CHEBI:4667) has part sodium valproate (CHEBI:9925) |
| IUPAC Name |
|---|
| sodium 2-propylpentanoate |
| Synonyms | Source |
|---|---|
| 2-Propylvaleric acid sodium salt | KEGG COMPOUND |
| A-44090 | ChEMBL |
| ABBOTT 44090 | ChEMBL |
| ABBOTT-44090 | ChEMBL |
| Depakene | KEGG COMPOUND |
| Epilim | ChemIDplus |
| Brand Names | Source |
|---|---|
| Depacon | ChEMBL |
| Epilim 200 | ChEMBL |
| Epilim 500 | ChEMBL |
| Epilim chrono 200 | ChEMBL |
| Epilim chrono 300 | ChEMBL |
| Epilim chrono 500 | ChEMBL |
| Manual Xrefs | Databases |
|---|---|
| D00710 | KEGG DRUG |
| DBSALT001257 | DrugBank |
| Registry Numbers | Sources |
|---|---|
| CAS:1069-66-5 | ChemIDplus |
| Citations |
|---|