EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C8H15O2.Na |
| Net Charge | 0 |
| Average Mass | 166.196 |
| Monoisotopic Mass | 166.09697 |
| SMILES | CCCC(CCC)C(=O)[O-].[Na+] |
| InChI | InChI=1S/C8H16O2.Na/c1-3-5-7(6-4-2)8(9)10;/h7H,3-6H2,1-2H3,(H,9,10);/q;+1/p-1 |
| InChIKey | AEQFSUDEHCCHBT-UHFFFAOYSA-M |
| Roles Classification |
|---|
| Biological Role: | EC 3.5.1.98 (histone deacetylase) inhibitor An EC 3.5.1.* (non-peptide linear amide C-N hydrolase) inhibitor that interferes with the function of histone deacetylase (EC 3.5.1.98). |
| Applications: | geroprotector Any compound that supports healthy aging, slows the biological aging process, or extends lifespan. anticonvulsant A drug used to prevent seizures or reduce their severity. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| sodium valproate (CHEBI:9925) has part valproate (CHEBI:60654) |
| sodium valproate (CHEBI:9925) has role anticonvulsant (CHEBI:35623) |
| sodium valproate (CHEBI:9925) has role EC 3.5.1.98 (histone deacetylase) inhibitor (CHEBI:61115) |
| sodium valproate (CHEBI:9925) has role geroprotector (CHEBI:176497) |
| sodium valproate (CHEBI:9925) is a organic sodium salt (CHEBI:38700) |
| Incoming Relation(s) |
| valproate semisodium (CHEBI:4667) has part sodium valproate (CHEBI:9925) |
| IUPAC Name |
|---|
| sodium 2-propylpentanoate |
| Synonyms | Source |
|---|---|
| 2-Propylvaleric acid sodium salt | KEGG COMPOUND |
| Depakene | KEGG COMPOUND |
| Epilim | ChemIDplus |
| Valproate sodium | KEGG COMPOUND |
| valproic acid sodium salt | ChEBI |
| Manual Xrefs | Databases |
|---|---|
| D00710 | KEGG DRUG |
| DBSALT001257 | DrugBank |
| Registry Numbers | Sources |
|---|---|
| CAS:1069-66-5 | ChemIDplus |
| Citations |
|---|