EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C8H16O2 |
| Net Charge | 0 |
| Average Mass | 144.214 |
| Monoisotopic Mass | 144.11503 |
| SMILES | CCCC(CCC)C(=O)O |
| InChI | InChI=1S/C8H16O2/c1-3-5-7(6-4-2)8(9)10/h7H,3-6H2,1-2H3,(H,9,10) |
| InChIKey | NIJJYAXOARWZEE-UHFFFAOYSA-N |
| Wikipedia |
|---|
| Roles Classification |
|---|
| Chemical Role: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| Biological Roles: | GABA agent A substance, such as agonists, antagonists, degradation or uptake inhibitors, depleters, precursors, and modulators of receptor function, used for its pharmacological actions on GABAergic systems. teratogenic agent A role played by a chemical compound in biological systems with adverse consequences in embryo developments, leading to birth defects, embryo death or altered development, growth retardation and functional defect. EC 3.5.1.98 (histone deacetylase) inhibitor An EC 3.5.1.* (non-peptide linear amide C-N hydrolase) inhibitor that interferes with the function of histone deacetylase (EC 3.5.1.98). |
| Applications: | antimanic drug Antimanic drugs are agents used to treat bipolar disorders or mania associated with other affective disorders. GABA agent A substance, such as agonists, antagonists, degradation or uptake inhibitors, depleters, precursors, and modulators of receptor function, used for its pharmacological actions on GABAergic systems. psychotropic drug A loosely defined grouping of drugs that have effects on psychological function. neuroprotective agent Any compound that can be used for the treatment of neurodegenerative disorders. anticonvulsant A drug used to prevent seizures or reduce their severity. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| valproic acid (CHEBI:39867) has functional parent valeric acid (CHEBI:17418) |
| valproic acid (CHEBI:39867) has role anticonvulsant (CHEBI:35623) |
| valproic acid (CHEBI:39867) has role antimanic drug (CHEBI:35477) |
| valproic acid (CHEBI:39867) has role EC 3.5.1.98 (histone deacetylase) inhibitor (CHEBI:61115) |
| valproic acid (CHEBI:39867) has role GABA agent (CHEBI:51374) |
| valproic acid (CHEBI:39867) has role neuroprotective agent (CHEBI:63726) |
| valproic acid (CHEBI:39867) has role psychotropic drug (CHEBI:35471) |
| valproic acid (CHEBI:39867) has role teratogenic agent (CHEBI:50905) |
| valproic acid (CHEBI:39867) is a branched-chain fatty acid (CHEBI:35819) |
| valproic acid (CHEBI:39867) is a branched-chain saturated fatty acid (CHEBI:39417) |
| valproic acid (CHEBI:39867) is conjugate acid of valproate (CHEBI:60654) |
| Incoming Relation(s) |
| valpromide (CHEBI:74562) has functional parent valproic acid (CHEBI:39867) |
| valproate semisodium (CHEBI:4667) has part valproic acid (CHEBI:39867) |
| valproate (CHEBI:60654) is conjugate base of valproic acid (CHEBI:39867) |
| IUPAC Name |
|---|
| 2-propylpentanoic acid |
| INNs | Source |
|---|---|
| acide valproïque | ChemIDplus |
| ácido valproico | ChemIDplus |
| acidum valproicum | ChemIDplus |
| valproic acid | ChemIDplus |
| Synonyms | Source |
|---|---|
| 2-n-propyl-n-valeric acid | NIST Chemistry WebBook |
| 2-propylpentanoic acid | ChEMBL |
| 2-PROPYL-PENTANOIC ACID | PDBeChem |
| 2-propylvaleric acid | ChemIDplus |
| 4-heptanecarboxylic acid | ChemIDplus |
| di-n-propylacetic acid | ChemIDplus |
| Brand Name | Source |
|---|---|
| Depakene | KEGG DRUG |
| Manual Xrefs | Databases |
|---|---|
| 2803 | DrugCentral |
| 2PP | PDBeChem |
| C07185 | KEGG COMPOUND |
| D00399 | KEGG DRUG |
| DB00313 | DrugBank |
| HMDB0001877 | HMDB |
| LMFA01020291 | LIPID MAPS |
| LSM-4620 | LINCS |
| Valproic_Acid | Wikipedia |
| Citations |
|---|