EMBL-EBI | Chemical Biology Resources | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
CHEBI:39867 - valproic acid
| Formula | C8H16O2 |
| Net Charge | 0 |
| Average Mass | 144.214 |
| Monoisotopic Mass | 144.11503 |
| SMILES | CCCC(CCC)C(=O)O |
| InChI | InChI=1S/C8H16O2/c1-3-5-7(6-4-2)8(9)10/h7H,3-6H2,1-2H3,(H,9,10) |
| InChIKey | NIJJYAXOARWZEE-UHFFFAOYSA-N |
| Wikipedia |
|---|
| Roles Classification |
|---|
| Chemical Role: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| Biological Roles: | teratogenic agent A role played by a chemical compound in biological systems with adverse consequences in embryo developments, leading to birth defects, embryo death or altered development, growth retardation and functional defect. EC 3.5.1.98 (histone deacetylase) inhibitor An EC 3.5.1.* (non-peptide linear amide C-N hydrolase) inhibitor that interferes with the function of histone deacetylase (EC 3.5.1.98). anti-HIV agent An antiviral agent that destroys or inhibits the replication of the human immunodeficiency virus. GABA agent A substance, such as agonists, antagonists, degradation or uptake inhibitors, depleters, precursors, and modulators of receptor function, used for its pharmacological actions on GABAergic systems. |
| Applications: | antidepressant Antidepressants are mood-stimulating drugs used primarily in the treatment of affective disorders and related conditions. antineoplastic agent A substance that inhibits or prevents the proliferation of neoplasms. anxiolytic drug Anxiolytic drugs are agents that alleviate anxiety, tension, and anxiety disorders, promote sedation, and have a calming effect without affecting clarity of consciousness or neurologic conditions. psychotropic drug A loosely defined grouping of drugs that have effects on psychological function. antipsychotic agent Antipsychotic drugs are agents that control agitated psychotic behaviour, alleviate acute psychotic states, reduce psychotic symptoms, and exert a quieting effect. anticonvulsant A drug used to prevent seizures or reduce their severity. neuroprotective agent Any compound that can be used for the treatment of neurodegenerative disorders. GABA agent A substance, such as agonists, antagonists, degradation or uptake inhibitors, depleters, precursors, and modulators of receptor function, used for its pharmacological actions on GABAergic systems. vulnerary A drug used in treating and healing of wounds. antimanic drug Antimanic drugs are agents used to treat bipolar disorders or mania associated with other affective disorders. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| valproic acid (CHEBI:39867) has functional parent valeric acid (CHEBI:17418) |
| valproic acid (CHEBI:39867) has role anti-HIV agent (CHEBI:64946) |
| valproic acid (CHEBI:39867) has role anticonvulsant (CHEBI:35623) |
| valproic acid (CHEBI:39867) has role antidepressant (CHEBI:35469) |
| valproic acid (CHEBI:39867) has role antimanic drug (CHEBI:35477) |
| valproic acid (CHEBI:39867) has role antineoplastic agent (CHEBI:35610) |
| valproic acid (CHEBI:39867) has role antipsychotic agent (CHEBI:35476) |
| valproic acid (CHEBI:39867) has role anxiolytic drug (CHEBI:35474) |
| valproic acid (CHEBI:39867) has role EC 3.5.1.98 (histone deacetylase) inhibitor (CHEBI:61115) |
| valproic acid (CHEBI:39867) has role GABA agent (CHEBI:51374) |
| valproic acid (CHEBI:39867) has role neuroprotective agent (CHEBI:63726) |
| valproic acid (CHEBI:39867) has role psychotropic drug (CHEBI:35471) |
| valproic acid (CHEBI:39867) has role teratogenic agent (CHEBI:50905) |
| valproic acid (CHEBI:39867) has role vulnerary (CHEBI:73336) |
| valproic acid (CHEBI:39867) is a branched-chain fatty acid (CHEBI:35819) |
| valproic acid (CHEBI:39867) is a branched-chain saturated fatty acid (CHEBI:39417) |
| valproic acid (CHEBI:39867) is conjugate acid of valproate (CHEBI:60654) |
| Incoming Relation(s) |
| valpromide (CHEBI:74562) has functional parent valproic acid (CHEBI:39867) |
| valproate semisodium (CHEBI:4667) has part valproic acid (CHEBI:39867) |
| valproate (CHEBI:60654) is conjugate base of valproic acid (CHEBI:39867) |
| IUPAC Name |
|---|
| 2-propylpentanoic acid |
| INNs | Source |
|---|---|
| acide valproïque | ChemIDplus |
| ácido valproico | ChemIDplus |
| acidum valproicum | ChemIDplus |
| valproic acid | ChemIDplus |
| Synonyms | Source |
|---|---|
| 2-n-propyl-n-valeric acid | NIST Chemistry WebBook |
| 2-propylpentanoic acid | ChEMBL |
| 2-PROPYL-PENTANOIC ACID | PDBeChem |
| 2-propylvaleric acid | ChemIDplus |
| 44089 | ChEMBL |
| 4-heptanecarboxylic acid | ChemIDplus |
| Brand Names | Source |
|---|---|
| Depakene | KEGG DRUG |
| Stavzor | ChEMBL |
| Manual Xrefs | Databases |
|---|---|
| 2803 | DrugCentral |
| 2PP | PDBeChem |
| C07185 | KEGG COMPOUND |
| D00399 | KEGG DRUG |
| DB00313 | DrugBank |
| HMDB0001877 | HMDB |
| LMFA01020291 | LIPID MAPS |
| LSM-4620 | LINCS |
| Valproic_Acid | Wikipedia |
| Citations |
|---|