EMBL-EBI | Chemical Biology Resources | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
CHEBI:39867 - valproic acid
| Formula | C8H16O2 |
| Net Charge | 0 |
| Average Mass | 144.214 |
| Monoisotopic Mass | 144.11503 |
| SMILES | CCCC(CCC)C(=O)O |
| InChI | InChI=1S/C8H16O2/c1-3-5-7(6-4-2)8(9)10/h7H,3-6H2,1-2H3,(H,9,10) |
| InChIKey | NIJJYAXOARWZEE-UHFFFAOYSA-N |
| Wikipedia |
|---|
| Roles Classification |
|---|
| Chemical Role: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| Biological Roles: | GABA agent A substance, such as agonists, antagonists, degradation or uptake inhibitors, depleters, precursors, and modulators of receptor function, used for its pharmacological actions on GABAergic systems. teratogenic agent A role played by a chemical compound in biological systems with adverse consequences in embryo developments, leading to birth defects, embryo death or altered development, growth retardation and functional defect. anti-HIV agent An antiviral agent that destroys or inhibits the replication of the human immunodeficiency virus. EC 3.5.1.98 (histone deacetylase) inhibitor An EC 3.5.1.* (non-peptide linear amide C-N hydrolase) inhibitor that interferes with the function of histone deacetylase (EC 3.5.1.98). |
| Applications: | anticonvulsant A drug used to prevent seizures or reduce their severity. vulnerary A drug used in treating and healing of wounds. antipsychotic agent Antipsychotic drugs are agents that control agitated psychotic behaviour, alleviate acute psychotic states, reduce psychotic symptoms, and exert a quieting effect. anxiolytic drug Anxiolytic drugs are agents that alleviate anxiety, tension, and anxiety disorders, promote sedation, and have a calming effect without affecting clarity of consciousness or neurologic conditions. antimanic drug Antimanic drugs are agents used to treat bipolar disorders or mania associated with other affective disorders. GABA agent A substance, such as agonists, antagonists, degradation or uptake inhibitors, depleters, precursors, and modulators of receptor function, used for its pharmacological actions on GABAergic systems. antineoplastic agent A substance that inhibits or prevents the proliferation of neoplasms. psychotropic drug A loosely defined grouping of drugs that have effects on psychological function. neuroprotective agent Any compound that can be used for the treatment of neurodegenerative disorders. antidepressant Antidepressants are mood-stimulating drugs used primarily in the treatment of affective disorders and related conditions. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| valproic acid (CHEBI:39867) has functional parent valeric acid (CHEBI:17418) |
| valproic acid (CHEBI:39867) has role anti-HIV agent (CHEBI:64946) |
| valproic acid (CHEBI:39867) has role anticonvulsant (CHEBI:35623) |
| valproic acid (CHEBI:39867) has role antidepressant (CHEBI:35469) |
| valproic acid (CHEBI:39867) has role antimanic drug (CHEBI:35477) |
| valproic acid (CHEBI:39867) has role antineoplastic agent (CHEBI:35610) |
| valproic acid (CHEBI:39867) has role antipsychotic agent (CHEBI:35476) |
| valproic acid (CHEBI:39867) has role anxiolytic drug (CHEBI:35474) |
| valproic acid (CHEBI:39867) has role EC 3.5.1.98 (histone deacetylase) inhibitor (CHEBI:61115) |
| valproic acid (CHEBI:39867) has role GABA agent (CHEBI:51374) |
| valproic acid (CHEBI:39867) has role neuroprotective agent (CHEBI:63726) |
| valproic acid (CHEBI:39867) has role psychotropic drug (CHEBI:35471) |
| valproic acid (CHEBI:39867) has role teratogenic agent (CHEBI:50905) |
| valproic acid (CHEBI:39867) has role vulnerary (CHEBI:73336) |
| valproic acid (CHEBI:39867) is a branched-chain fatty acid (CHEBI:35819) |
| valproic acid (CHEBI:39867) is a branched-chain saturated fatty acid (CHEBI:39417) |
| valproic acid (CHEBI:39867) is conjugate acid of valproate (CHEBI:60654) |
| Incoming Relation(s) |
| valpromide (CHEBI:74562) has functional parent valproic acid (CHEBI:39867) |
| valproate semisodium (CHEBI:4667) has part valproic acid (CHEBI:39867) |
| valproate (CHEBI:60654) is conjugate base of valproic acid (CHEBI:39867) |
| IUPAC Name |
|---|
| 2-propylpentanoic acid |
| INNs | Source |
|---|---|
| acide valproïque | ChemIDplus |
| ácido valproico | ChemIDplus |
| acidum valproicum | ChemIDplus |
| valproic acid | ChemIDplus |
| Synonyms | Source |
|---|---|
| 2-n-propyl-n-valeric acid | NIST Chemistry WebBook |
| 2-propylpentanoic acid | ChEMBL |
| 2-PROPYL-PENTANOIC ACID | PDBeChem |
| 2-propylvaleric acid | ChemIDplus |
| 44089 | ChEMBL |
| 4-heptanecarboxylic acid | ChemIDplus |
| Brand Names | Source |
|---|---|
| Depakene | KEGG DRUG |
| Stavzor | ChEMBL |
| Manual Xrefs | Databases |
|---|---|
| 2803 | DrugCentral |
| 2PP | PDBeChem |
| C07185 | KEGG COMPOUND |
| D00399 | KEGG DRUG |
| DB00313 | DrugBank |
| HMDB0001877 | HMDB |
| LMFA01020291 | LIPID MAPS |
| LSM-4620 | LINCS |
| Valproic_Acid | Wikipedia |
| Citations |
|---|