EMBL-EBI | Chemical Biology Resources | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C28H32O15 |
| Net Charge | 0 |
| Average Mass | 608.549 |
| Monoisotopic Mass | 608.17412 |
| SMILES | COc1ccc(-c2cc(=O)c3c(O)cc(O[C@@H]4O[C@H](CO[C@@H]5O[C@@H](C)[C@H](O)[C@@H](O)[C@H]5O)[C@@H](O)[C@H](O)[C@H]4O)cc3o2)cc1O |
| InChI | InChI=1S/C28H32O15/c1-10-21(32)23(34)25(36)27(40-10)39-9-19-22(33)24(35)26(37)28(43-19)41-12-6-14(30)20-15(31)8-17(42-18(20)7-12)11-3-4-16(38-2)13(29)5-11/h3-8,10,19,21-30,32-37H,9H2,1-2H3/t10-,19+,21-,22+,23+,24-,25+,26+,27+,28+/m0/s1 |
| InChIKey | GZSOSUNBTXMUFQ-YFAPSIMESA-N |
| Wikipedia |
|---|
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Desmodium styracifolium (ncbitaxon:648866) | - | PubMed (25620156) |
| Roles Classification |
|---|
| Chemical Role: | antioxidant A substance that opposes oxidation or inhibits reactions brought about by dioxygen or peroxides. |
| Applications: | antirheumatic drug A drug used to treat rheumatoid arthritis. anti-inflammatory agent Any compound that has anti-inflammatory effects. cardiovascular drug A drug that affects the rate or intensity of cardiac contraction, blood vessel diameter or blood volume. anti-ulcer drug One of various classes of drugs with different action mechanisms used to treat or ameliorate peptic ulcer or irritation of the gastrointestinal tract. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| diosmin (CHEBI:4631) has functional parent diosmetin (CHEBI:4630) |
| diosmin (CHEBI:4631) has role anti-inflammatory agent (CHEBI:67079) |
| diosmin (CHEBI:4631) has role anti-ulcer drug (CHEBI:49201) |
| diosmin (CHEBI:4631) has role antioxidant (CHEBI:22586) |
| diosmin (CHEBI:4631) has role antirheumatic drug (CHEBI:35842) |
| diosmin (CHEBI:4631) has role cardiovascular drug (CHEBI:35554) |
| diosmin (CHEBI:4631) is a dihydroxyflavanone (CHEBI:38749) |
| diosmin (CHEBI:4631) is a disaccharide derivative (CHEBI:63353) |
| diosmin (CHEBI:4631) is a glycosyloxyflavone (CHEBI:50018) |
| diosmin (CHEBI:4631) is a monomethoxyflavone (CHEBI:25401) |
| diosmin (CHEBI:4631) is a rutinoside (CHEBI:26587) |
| IUPAC Name |
|---|
| 5-hydroxy-2-(3-hydroxy-4-methoxyphenyl)-4-oxo-4H-1-benzopyran-7-yl 6-O-(6-deoxy-α-L-mannopyranosyl)-β-D-glucopyranoside |
| INNs | Source |
|---|---|
| diosmin | ChemIDplus |
| diosmina | WHO MedNet |
| diosmine | ChemIDplus |
| diosminum | ChemIDplus |
| Synonyms | Source |
|---|---|
| 3',5,7-trihydroxy-4'-methoxyflavone 7-rhamnoglucoside | ChEBI |
| 3',5,7-trihydroxy-4'-methoxyflavone-7-rutinoside | ChEBI |
| Buchu resin | ChEMBL |
| Daflon | ChEMBL |
| diosmetin 7-neohesperidoside | LIPID MAPS |
| Diosmetin 7-O-rutinoside | KEGG COMPOUND |
| Brand Name | Source |
|---|---|
| Diovenor | ChEMBL |
| Citations |
|---|