EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C17H22N2O3 |
| Net Charge | 0 |
| Average Mass | 302.374 |
| Monoisotopic Mass | 302.16304 |
| SMILES | CC(/C=C/C(=O)NO)=C\[C@@H](C)C(=O)c1ccc(N(C)C)cc1 |
| InChI | InChI=1S/C17H22N2O3/c1-12(5-10-16(20)18-22)11-13(2)17(21)14-6-8-15(9-7-14)19(3)4/h5-11,13,22H,1-4H3,(H,18,20)/b10-5+,12-11+/t13-/m1/s1 |
| InChIKey | RTKIYFITIVXBLE-QEQCGCAPSA-N |
| Wikipedia |
|---|
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Streptomyces hygroscopicus (ncbitaxon:1912) | - | PubMed (21504214) |
| Roles Classification |
|---|
| Biological Roles: | bacterial metabolite Any prokaryotic metabolite produced during a metabolic reaction in bacteria. EC 3.5.1.98 (histone deacetylase) inhibitor An EC 3.5.1.* (non-peptide linear amide C-N hydrolase) inhibitor that interferes with the function of histone deacetylase (EC 3.5.1.98). antifungal agent An antimicrobial agent that destroys fungi by suppressing their ability to grow or reproduce. antimicrobial agent A substance that kills or slows the growth of microorganisms, including bacteria, viruses, fungi and protozoans. |
| Application: | geroprotector Any compound that supports healthy aging, slows the biological aging process, or extends lifespan. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| trichostatin A (CHEBI:46024) has functional parent (R)-trichostatic acid (CHEBI:39158) |
| trichostatin A (CHEBI:46024) has role bacterial metabolite (CHEBI:76969) |
| trichostatin A (CHEBI:46024) has role EC 3.5.1.98 (histone deacetylase) inhibitor (CHEBI:61115) |
| trichostatin A (CHEBI:46024) has role geroprotector (CHEBI:176497) |
| trichostatin A (CHEBI:46024) is a antibiotic antifungal agent (CHEBI:86478) |
| trichostatin A (CHEBI:46024) is a hydroxamic acid (CHEBI:24650) |
| trichostatin A (CHEBI:46024) is a trichostatin (CHEBI:39146) |
| Incoming Relation(s) |
| trichostatin C (CHEBI:39147) has functional parent trichostatin A (CHEBI:46024) |
| trichostatin D (CHEBI:39160) has functional parent trichostatin A (CHEBI:46024) |
| IUPAC Name |
|---|
| (2E,4E,6R)-7-[4-(dimethylamino)phenyl]-N-hydroxy-4,6-dimethyl-7-oxohepta-2,4-dienamide |
| Synonyms | Source |
|---|---|
| TRICHOSTATIN A | PDBeChem |
| (2E,4E,6R)-7-(4-(dimethylamino)phenyl)-N-hydroxy-4,6-dimethyl-7-oxo-2,4-heptadienamide | ChemIDplus |
| TSA | ChemIDplus |
| Manual Xrefs | Databases |
|---|---|
| TSN | PDBeChem |
| DB04297 | DrugBank |
| C00016002 | KNApSAcK |
| Trichostatin_A | Wikipedia |
| HMDB0259177 | HMDB |
| Registry Numbers | Sources |
|---|---|
| Beilstein:5291761 | Beilstein |
| CAS:58880-19-6 | ChemIDplus |
| Citations |
|---|