EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C23H32N2O8 |
| Net Charge | 0 |
| Average Mass | 464.515 |
| Monoisotopic Mass | 464.21587 |
| SMILES | CC(/C=C/C(=O)NO[C@@H]1O[C@H](CO)[C@@H](O)[C@H](O)[C@H]1O)=C\[C@@H](C)C(=O)c1ccc(N(C)C)cc1 |
| InChI | InChI=1S/C23H32N2O8/c1-13(11-14(2)19(28)15-6-8-16(9-7-15)25(3)4)5-10-18(27)24-33-23-22(31)21(30)20(29)17(12-26)32-23/h5-11,14,17,20-23,26,29-31H,12H2,1-4H3,(H,24,27)/b10-5+,13-11+/t14-,17-,20-,21+,22-,23+/m1/s1 |
| InChIKey | YECWTLGLNDDPGE-PIFXLSLCSA-N |
| Roles Classification |
|---|
| Biological Role: | antimicrobial agent A substance that kills or slows the growth of microorganisms, including bacteria, viruses, fungi and protozoans. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| trichostatin C (CHEBI:39147) has functional parent trichostatin A (CHEBI:46024) |
| trichostatin C (CHEBI:39147) is a O-amino sugar (CHEBI:51476) |
| trichostatin C (CHEBI:39147) is a trichostatin (CHEBI:39146) |
| IUPAC Name |
|---|
| 1-O-({(2E,4E,6R)-7-[4-(dimethylamino)phenyl]-4,6-dimethyl-7-oxohepta-2,4-dienoyl}amino)-β-D-glucopyranose |
| Synonyms | Source |
|---|---|
| 7-(4-(dimethylamino)phenyl)-N-(β-D-glucopyranosyloxy)-4,6-dimethyl-7-oxo-2,4-heptadienamide | ChemIDplus |
| Trichostatin C | ChemIDplus |
| Registry Numbers | Sources |
|---|---|
| Beilstein:9234979 | Beilstein |
| CAS:68676-88-0 | ChemIDplus |