EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C17H21NO3 |
| Net Charge | 0 |
| Average Mass | 287.359 |
| Monoisotopic Mass | 287.15214 |
| SMILES | CC(/C=C/C(=O)O)=C\[C@@H](C)C(=O)c1ccc(N(C)C)cc1 |
| InChI | InChI=1S/C17H21NO3/c1-12(5-10-16(19)20)11-13(2)17(21)14-6-8-15(9-7-14)18(3)4/h5-11,13H,1-4H3,(H,19,20)/b10-5+,12-11+/t13-/m1/s1 |
| InChIKey | VKEITMNFEJHFCX-QEQCGCAPSA-N |
| Roles Classification |
|---|
| Chemical Role: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| (R)-trichostatic acid (CHEBI:39158) is a trichostatic acid (CHEBI:39157) |
| (R)-trichostatic acid (CHEBI:39158) is enantiomer of (S)-trichostatic acid (CHEBI:39159) |
| Incoming Relation(s) |
| trichostatin A (CHEBI:46024) has functional parent (R)-trichostatic acid (CHEBI:39158) |
| (S)-trichostatic acid (CHEBI:39159) is enantiomer of (R)-trichostatic acid (CHEBI:39158) |
| IUPAC Name |
|---|
| (2E,4E,6R)-7-[4-(dimethylamino)phenyl]-4,6-dimethyl-7-oxohepta-2,4-dienoic acid |
| Synonyms | Source |
|---|---|
| (+)-Trichostatsäure | ChEBI |
| (+)-trichostatic acid | ChEBI |
| Registry Numbers | Sources |
|---|---|
| Beilstein:5284073 | Beilstein |
| Beilstein:6893749 | Beilstein |