EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C10H14N2O6 |
| Net Charge | 0 |
| Average Mass | 258.230 |
| Monoisotopic Mass | 258.08519 |
| SMILES | Cc1cn([C@@H]2O[C@H](CO)[C@@H](O)[C@H]2O)c(=O)nc1=O |
| InChI | InChI=1S/C10H14N2O6/c1-4-2-12(10(17)11-8(4)16)9-7(15)6(14)5(3-13)18-9/h2,5-7,9,13-15H,3H2,1H3,(H,11,16,17)/t5-,6-,7-,9-/m1/s1 |
| InChIKey | DWRXFEITVBNRMK-JXOAFFINSA-N |
| Wikipedia |
|---|
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Homo sapiens (ncbitaxon:9606) | - | PubMed (15607313) | |
| Escherichia coli (ncbitaxon:562) | - | PubMed (1100617) | Strain: K-12 |
| Roles Classification |
|---|
| Biological Roles: | Escherichia coli metabolite Any bacterial metabolite produced during a metabolic reaction in Escherichia coli. human metabolite Any mammalian metabolite produced during a metabolic reaction in humans (Homo sapiens). antigen Any substance that stimulates an immune response in the body, such as through antibody production or by presentation to a T-cell receptor after binding to a major histocompability complex (MHC). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| ribothymidine (CHEBI:45996) has role Escherichia coli metabolite (CHEBI:76971) |
| ribothymidine (CHEBI:45996) has role antigen (CHEBI:59132) |
| ribothymidine (CHEBI:45996) has role human metabolite (CHEBI:77746) |
| ribothymidine (CHEBI:45996) is a methyluridine (CHEBI:25347) |
| Incoming Relation(s) |
| TDP (CHEBI:61377) has functional parent ribothymidine (CHEBI:45996) |
| TMP (CHEBI:45394) has functional parent ribothymidine (CHEBI:45996) |
| IUPAC Name |
|---|
| 5-methyluridine |
| Synonyms | Source |
|---|---|
| Thymine riboside | ChemIDplus |
| 1-(β-D-ribofuranosyl)thymine | ChEBI |
| ribosylthymidine | ChEBI |
| t | ChEBI |
| Manual Xrefs | Databases |
|---|---|
| HMDB0000884 | HMDB |
| 5-methyluridine | Wikipedia |
| CPD-15123 | MetaCyc |
| ECMDB21389 | ECMDB |
| Registry Numbers | Sources |
|---|---|
| Reaxys:90164 | Reaxys |
| CAS:1463-10-1 | ChemIDplus |
| Citations |
|---|