EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C10H15N2O9P |
| Net Charge | 0 |
| Average Mass | 338.209 |
| Monoisotopic Mass | 338.05152 |
| SMILES | Cc1cn([C@@H]2O[C@H](COP(=O)(O)O)[C@@H](O)[C@H]2O)c(=O)nc1=O |
| InChI | InChI=1S/C10H15N2O9P/c1-4-2-12(10(16)11-8(4)15)9-7(14)6(13)5(21-9)3-20-22(17,18)19/h2,5-7,9,13-14H,3H2,1H3,(H,11,15,16)(H2,17,18,19)/t5-,6-,7-,9-/m1/s1 |
| InChIKey | IGWHDMPTQKSDTL-JXOAFFINSA-N |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| TMP (CHEBI:45394) has functional parent ribothymidine (CHEBI:45996) |
| TMP (CHEBI:45394) is a pyrimidine ribonucleoside 5'-monophosphate (CHEBI:39457) |
| TMP (CHEBI:45394) is conjugate acid of TMP(2−) (CHEBI:142797) |
| Incoming Relation(s) |
| rRNA containing C5-methyluridine (CHEBI:149725) has functional parent TMP (CHEBI:45394) |
| TMP(2−) (CHEBI:142797) is conjugate base of TMP (CHEBI:45394) |
| IUPAC Name |
|---|
| 5-methyluridine 5'-(dihydrogen phosphate) |
| Synonyms | Source |
|---|---|
| 5-methyl-5'-uridylic acid | ChEBI |
| 5-methyluridine 5'-(dihydrogen phosphate) | PDBeChem |
| 5-Methyluridine 5'-Monophosphate | DrugBank |
| 5-methyluridine 5'-phosphate | ChEBI |
| 5-Methyluridine monophosphate | SUBMITTER |
| 5mUMP | SUBMITTER |
| Citations |
|---|