EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C10H16N2O12P2 |
| Net Charge | 0 |
| Average Mass | 418.188 |
| Monoisotopic Mass | 418.01785 |
| SMILES | Cc1cn([C@@H]2O[C@H](COP(=O)(O)OP(=O)(O)O)[C@@H](O)[C@H]2O)c(=O)nc1=O |
| InChI | InChI=1S/C10H16N2O12P2/c1-4-2-12(10(16)11-8(4)15)9-7(14)6(13)5(23-9)3-22-26(20,21)24-25(17,18)19/h2,5-7,9,13-14H,3H2,1H3,(H,20,21)(H,11,15,16)(H2,17,18,19)/t5-,6-,7-,9-/m1/s1 |
| InChIKey | CYDYNVMCEGXBEM-JXOAFFINSA-N |
| Roles Classification |
|---|
| Biological Role: | mouse metabolite Any mammalian metabolite produced during a metabolic reaction in a mouse (Mus musculus). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| TDP (CHEBI:61377) has functional parent ribothymidine (CHEBI:45996) |
| TDP (CHEBI:61377) is a pyrimidine ribonucleoside 5'-diphosphate (CHEBI:37039) |
| TDP (CHEBI:61377) is conjugate acid of TDP(3−) (CHEBI:61417) |
| Incoming Relation(s) |
| TDP(3−) (CHEBI:61417) is conjugate base of TDP (CHEBI:61377) |
| IUPAC Name |
|---|
| 5-methyluridine 5'-(trihydrogen diphosphate) |
| Synonyms | Source |
|---|---|
| 5-methyl-O5'-trihydroxydiphosphoryluridine | ChEBI |
| 5'-ribosylthymidylate diphosphate | ChEBI |
| 5' rTDP | ChEBI |
| 5'-rTDP | ChEBI |
| ribosylthymidine 5'-diphosphate | ChEBI |
| ribosylthymidine diphosphate | ChEBI |