EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
CHEBI:15671 - L-tartaric acid
| Formula | C4H6O6 |
| Net Charge | 0 |
| Average Mass | 150.086 |
| Monoisotopic Mass | 150.01644 |
| SMILES | O=C(O)[C@H](O)[C@@H](O)C(=O)O |
| InChI | InChI=1S/C4H6O6/c5-1(3(7)8)2(6)4(9)10/h1-2,5-6H,(H,7,8)(H,9,10)/t1-,2-/m1/s1 |
| InChIKey | FEWJPZIEWOKRBE-JCYAYHJZSA-N |
| Roles Classification |
|---|
| Chemical Roles: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| Biological Roles: | plant metabolite Any eukaryotic metabolite produced during a metabolic reaction in plants, the kingdom that include flowering plants, conifers and other gymnosperms. human xenobiotic metabolite Any human metabolite produced by metabolism of a xenobiotic compound in humans. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| L-tartaric acid (CHEBI:15671) is a 2,3-dihydroxybutanedioic acid (CHEBI:15674) |
| L-tartaric acid (CHEBI:15671) is conjugate acid of L-tartrate(1−) (CHEBI:35398) |
| L-tartaric acid (CHEBI:15671) is enantiomer of D-tartaric acid (CHEBI:15672) |
| Incoming Relation(s) |
| (2R,3R)-cis-fertaric acid (CHEBI:76115) has functional parent L-tartaric acid (CHEBI:15671) |
| (2R,3R)-trans-fertaric acid (CHEBI:76116) has functional parent L-tartaric acid (CHEBI:15671) |
| DL-tartaric acid (CHEBI:26849) has part L-tartaric acid (CHEBI:15671) |
| L-tartrate(1−) (CHEBI:35398) is conjugate base of L-tartaric acid (CHEBI:15671) |
| D-tartaric acid (CHEBI:15672) is enantiomer of L-tartaric acid (CHEBI:15671) |
| IUPAC Name |
|---|
| (2R,3R)-2,3-dihydroxybutanedioic acid |
| Synonyms | Source |
|---|---|
| (R,R)-Tartaric acid | KEGG COMPOUND |
| L-Tartaric acid | KEGG COMPOUND |
| (2R,3R)-tartaric acid | IUPAC |
| L-threaric acid | IUPAC |
| (+)-tartaric acid | IUPAC |
| (2R,3R)-2,3-dihydroxysuccinic acid | ChEBI |