EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C15H12I3NO4 |
| Net Charge | 0 |
| Average Mass | 650.976 |
| Monoisotopic Mass | 650.79005 |
| SMILES | N[C@@H](Cc1cc(I)c(Oc2ccc(O)c(I)c2)c(I)c1)C(=O)O |
| InChI | InChI=1S/C15H12I3NO4/c16-9-6-8(1-2-13(9)20)23-14-10(17)3-7(4-11(14)18)5-12(19)15(21)22/h1-4,6,12,20H,5,19H2,(H,21,22)/t12-/m0/s1 |
| InChIKey | AUYYCJSJGJYCDS-LBPRGKRZSA-N |
| Wikipedia |
|---|
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Homo sapiens (ncbitaxon:9606) | - | DOI (10.1038/nbt.2488) | |
| Mus musculus (ncbitaxon:10090) | - | PubMed (19425150) | Source: BioModels - MODEL1507180067 |
| Roles Classification |
|---|
| Chemical Roles: | Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| Biological Roles: | human metabolite Any mammalian metabolite produced during a metabolic reaction in humans (Homo sapiens). thyroid hormone Any hormone produced by the thyroid gland immunosuppressive agent An agent that suppresses immune function by one of several mechanisms of action. Classical cytotoxic immunosuppressants act by inhibiting DNA synthesis. Others may act through activation of T-cells or by inhibiting the activation of helper cells. In addition, an immunosuppressive agent is a role played by a compound which is exhibited by a capability to diminish the extent and/or voracity of an immune response. mouse metabolite Any mammalian metabolite produced during a metabolic reaction in a mouse (Mus musculus). |
| Applications: | antineoplastic agent A substance that inhibits or prevents the proliferation of neoplasms. cardiovascular drug A drug that affects the rate or intensity of cardiac contraction, blood vessel diameter or blood volume. anti-arrhythmia drug A drug used for the treatment or prevention of cardiac arrhythmias. Anti-arrhythmia drugs may affect the polarisation-repolarisation phase of the action potential, its excitability or refractoriness, or impulse conduction or membrane responsiveness within cardiac fibres. antidepressant Antidepressants are mood-stimulating drugs used primarily in the treatment of affective disorders and related conditions. antipsychotic agent Antipsychotic drugs are agents that control agitated psychotic behaviour, alleviate acute psychotic states, reduce psychotic symptoms, and exert a quieting effect. immunosuppressive agent An agent that suppresses immune function by one of several mechanisms of action. Classical cytotoxic immunosuppressants act by inhibiting DNA synthesis. Others may act through activation of T-cells or by inhibiting the activation of helper cells. In addition, an immunosuppressive agent is a role played by a compound which is exhibited by a capability to diminish the extent and/or voracity of an immune response. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 3,3',5-triiodo-L-thyronine (CHEBI:18258) has role anti-arrhythmia drug (CHEBI:38070) |
| 3,3',5-triiodo-L-thyronine (CHEBI:18258) has role antidepressant (CHEBI:35469) |
| 3,3',5-triiodo-L-thyronine (CHEBI:18258) has role antineoplastic agent (CHEBI:35610) |
| 3,3',5-triiodo-L-thyronine (CHEBI:18258) has role antipsychotic agent (CHEBI:35476) |
| 3,3',5-triiodo-L-thyronine (CHEBI:18258) has role cardiovascular drug (CHEBI:35554) |
| 3,3',5-triiodo-L-thyronine (CHEBI:18258) has role human metabolite (CHEBI:77746) |
| 3,3',5-triiodo-L-thyronine (CHEBI:18258) has role immunosuppressive agent (CHEBI:35705) |
| 3,3',5-triiodo-L-thyronine (CHEBI:18258) has role mouse metabolite (CHEBI:75771) |
| 3,3',5-triiodo-L-thyronine (CHEBI:18258) has role thyroid hormone (CHEBI:60311) |
| 3,3',5-triiodo-L-thyronine (CHEBI:18258) is a 2-halophenol (CHEBI:53291) |
| 3,3',5-triiodo-L-thyronine (CHEBI:18258) is a iodophenol (CHEBI:24863) |
| 3,3',5-triiodo-L-thyronine (CHEBI:18258) is a iodothyronine (CHEBI:24864) |
| 3,3',5-triiodo-L-thyronine (CHEBI:18258) is conjugate acid of 3,3',5-triiodo-L-thyroninate (CHEBI:60308) |
| 3,3',5-triiodo-L-thyronine (CHEBI:18258) is tautomer of 3,3',5-triiodo-L-thyronine zwitterion (CHEBI:533015) |
| Incoming Relation(s) |
| 3,3',5-triiodo-L-thyronine sulfate (CHEBI:35432) has functional parent 3,3',5-triiodo-L-thyronine (CHEBI:18258) |
| desiccated thyroid extract (CHEBI:9584) has part 3,3',5-triiodo-L-thyronine (CHEBI:18258) |
| 3,3',5-triiodo-L-thyroninate (CHEBI:60308) is conjugate base of 3,3',5-triiodo-L-thyronine (CHEBI:18258) |
| 3,3',5-triiodo-L-thyronine residue (CHEBI:90874) is substituent group from 3,3',5-triiodo-L-thyronine (CHEBI:18258) |
| 3,3',5-triiodo-L-thyronine zwitterion (CHEBI:533015) is tautomer of 3,3',5-triiodo-L-thyronine (CHEBI:18258) |
| IUPAC Name |
|---|
| 3,3',5-triiodo-L-thyronine |
| INNs | Source |
|---|---|
| liothyronine | ChemIDplus |
| liothyronine | ChEBI |
| liothyroninum | ChemIDplus |
| liotironina | ChemIDplus |
| Synonyms | Source |
|---|---|
| 3,5,3'-Triiodo-L-thyronine | KEGG COMPOUND |
| 3,5,3'TRIIODOTHYRONINE | PDBeChem |
| 3,5,3'-Triiodothyronine | KEGG COMPOUND |
| 3,5,3'-triiodothyronine, l- | ChEMBL |
| 4-(4-hydroxy-3-iodophenoxy)-3,5-diiodo-L-phenylalanine | IUPAC |
| O-(4-hydroxy-3-iodophenyl)-3,5-diiodo-L-tyrosine | IUPAC |
| Brand Names | Source |
|---|---|
| Tertroxin | DrugBank |
| Tresitope | DrugBank |
| Manual Xrefs | Databases |
|---|---|
| 1585 | DrugCentral |
| C02465 | KEGG COMPOUND |
| D08128 | KEGG DRUG |
| DB00279 | DrugBank |
| HMDB0000265 | HMDB |
| LSM-3991 | LINCS |
| T3 | PDBeChem |
| Triiodothyronine | Wikipedia |
| Registry Numbers | Sources |
|---|---|
| Reaxys:2710227 | Reaxys |
| CAS:6893-02-3 | ChemIDplus |
| CAS:6893-02-3 | KEGG COMPOUND |
| Citations |
|---|