EMBL-EBI | Chemical Biology Resources | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C12H22O11 |
| Net Charge | 0 |
| Average Mass | 342.297 |
| Monoisotopic Mass | 342.11621 |
| SMILES | OC[C@H]1O[C@@](CO)(O[C@H]2O[C@H](CO)[C@@H](O)[C@H](O)[C@H]2O)[C@@H](O)[C@@H]1O |
| WURCS | WURCS=2.0/2,2,1/[a2122h-1a_1-5][ha122h-2b_2-5]/1-2/a1-b2 |
| InChI | InChI=1S/C12H22O11/c13-1-4-6(16)8(18)9(19)11(21-4)23-12(3-15)10(20)7(17)5(2-14)22-12/h4-11,13-20H,1-3H2/t4-,5-,6-,7-,8+,9-,10+,11-,12+/m1/s1 |
| InChIKey | CZMRCDWAGMRECN-UGDNZRGBSA-N |
| Wikipedia |
|---|
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Chlamydomonas reinhardtii (ncbitaxon:3055) | - | PubMed (25515814) | |
| Escherichia coli (ncbitaxon:562) | - | PubMed (21988831) | |
| Homo sapiens (ncbitaxon:9606) | - | DOI (10.1038/nbt.2488) | |
| Mus musculus (ncbitaxon:10090) | - | PubMed (19425150) | Source: BioModels - MODEL1507180067 |
| Saccharomyces cerevisiae (ncbitaxon:4932) | - | PubMed (24678285) | Source: yeast.sf.net |
| Roles Classification |
|---|
| Chemical Role: | sweetening agent Substance that sweeten food, beverages, medications, etc. |
| Biological Roles: | human metabolite Any mammalian metabolite produced during a metabolic reaction in humans (Homo sapiens). mouse metabolite Any mammalian metabolite produced during a metabolic reaction in a mouse (Mus musculus). Saccharomyces cerevisiae metabolite Any fungal metabolite produced during a metabolic reaction in Baker's yeast (Saccharomyces cerevisiae ). Escherichia coli metabolite Any bacterial metabolite produced during a metabolic reaction in Escherichia coli. algal metabolite Any eukaryotic metabolite produced during a metabolic reaction in algae including unicellular organisms like chlorella and diatoms to multicellular organisms like giant kelps and brown algae. osmolyte A solute used by a cell under water stress to maintain cell volume. analgesic An agent capable of relieving pain without the loss of consciousness or without producing anaesthesia. In addition, analgesic is a role played by a compound which is exhibited by a capability to cause a reduction of pain symptoms. sweetening agent Substance that sweeten food, beverages, medications, etc. |
| Applications: | cardiovascular drug A drug that affects the rate or intensity of cardiac contraction, blood vessel diameter or blood volume. analgesic An agent capable of relieving pain without the loss of consciousness or without producing anaesthesia. In addition, analgesic is a role played by a compound which is exhibited by a capability to cause a reduction of pain symptoms. sweetening agent Substance that sweeten food, beverages, medications, etc. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| sucrose (CHEBI:17992) has role Escherichia coli metabolite (CHEBI:76971) |
| sucrose (CHEBI:17992) has role Saccharomyces cerevisiae metabolite (CHEBI:75772) |
| sucrose (CHEBI:17992) has role algal metabolite (CHEBI:84735) |
| sucrose (CHEBI:17992) has role analgesic (CHEBI:35480) |
| sucrose (CHEBI:17992) has role cardiovascular drug (CHEBI:35554) |
| sucrose (CHEBI:17992) has role human metabolite (CHEBI:77746) |
| sucrose (CHEBI:17992) has role mouse metabolite (CHEBI:75771) |
| sucrose (CHEBI:17992) has role osmolyte (CHEBI:25728) |
| sucrose (CHEBI:17992) has role sweetening agent (CHEBI:50505) |
| sucrose (CHEBI:17992) is a glycosyl glycoside (CHEBI:24407) |
| Incoming Relation(s) |
| 1,6-kestotetraose (CHEBI:64835) has functional parent sucrose (CHEBI:17992) |
| 6-kestotriose (CHEBI:64833) has functional parent sucrose (CHEBI:17992) |
| 6,6-kestotetraose (CHEBI:64836) has functional parent sucrose (CHEBI:17992) |
| agrocinopine A (CHEBI:82804) has functional parent sucrose (CHEBI:17992) |
| agrocinopine C (CHEBI:82807) has functional parent sucrose (CHEBI:17992) |
| stachyose (CHEBI:17164) has functional parent sucrose (CHEBI:17992) |
| sucrose 6F-phosphate (CHEBI:16308) has functional parent sucrose (CHEBI:17992) |
| sucrose 6G-phosphate (CHEBI:131603) has functional parent sucrose (CHEBI:17992) |
| β-D-fructofuranosyl 6-O-octanoyl-α-D-glucopyranoside (CHEBI:39724) has functional parent sucrose (CHEBI:17992) |
| molasses (CHEBI:83163) has part sucrose (CHEBI:17992) |
| IUPAC Name |
|---|
| β-D-fructofuranosyl α-D-glucopyranoside |
| Synonyms | Source |
|---|---|
| 1-alpha-D-Glucopyranosyl-2-beta-D-fructofuranoside | KEGG COMPOUND |
| Cane sugar | KEGG COMPOUND |
| GNE-410 | ChEMBL |
| NSC-406942 | ChEMBL |
| S-67F | ChEMBL |
| sacarosa | ChEBI |
| UniProt Name | Source |
|---|---|
| sucrose | UniProt |
| Citations |
|---|