EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C5H8O3 |
| Net Charge | 0 |
| Average Mass | 116.116 |
| Monoisotopic Mass | 116.04734 |
| SMILES | CC(=O)CCC(=O)O |
| InChI | InChI=1S/C5H8O3/c1-4(6)2-3-5(7)8/h2-3H2,1H3,(H,7,8) |
| InChIKey | JOOXCMJARBKPKM-UHFFFAOYSA-N |
| Wikipedia |
|---|
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Pleione bulbocodioides (ncbitaxon:141752) | - | PubMed (23627123) |
| Roles Classification |
|---|
| Chemical Role: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| Biological Role: | plant metabolite Any eukaryotic metabolite produced during a metabolic reaction in plants, the kingdom that include flowering plants, conifers and other gymnosperms. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 4-oxopentanoic acid (CHEBI:45630) has role plant metabolite (CHEBI:76924) |
| 4-oxopentanoic acid (CHEBI:45630) is a oxopentanoic acid (CHEBI:25799) |
| 4-oxopentanoic acid (CHEBI:45630) is a straight-chain saturated fatty acid (CHEBI:39418) |
| 4-oxopentanoic acid (CHEBI:45630) is conjugate acid of 4-oxopentanoate (CHEBI:39150) |
| Incoming Relation(s) |
| 5-aminolevulinic acid (CHEBI:17549) has functional parent 4-oxopentanoic acid (CHEBI:45630) |
| 4-oxopentanoate (CHEBI:39150) is conjugate base of 4-oxopentanoic acid (CHEBI:45630) |
| IUPAC Name |
|---|
| 4-oxopentanoic acid |
| Synonyms | Source |
|---|---|
| 3-acetylpropionic acid | ChemIDplus |
| 3-ketobutane-1-carboxylic acid | ChemIDplus |
| 4-ketovaleric acid | ChemIDplus |
| 4-oxovaleric acid | NIST Chemistry WebBook |
| LAEVULINIC ACID | PDBeChem |
| Lävulinsäure | ChEBI |
| Manual Xrefs | Databases |
|---|---|
| DB02239 | DrugBank |
| HMDB0000720 | HMDB |
| Levulinic_acid | Wikipedia |
| LMFA01060006 | LIPID MAPS |
| SHF | PDBeChem |
| Citations |
|---|