EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C5H7O3 |
| Net Charge | -1 |
| Average Mass | 115.108 |
| Monoisotopic Mass | 115.04007 |
| SMILES | CC(=O)CCC(=O)[O-] |
| InChI | InChI=1S/C5H8O3/c1-4(6)2-3-5(7)8/h2-3H2,1H3,(H,7,8)/p-1 |
| InChIKey | JOOXCMJARBKPKM-UHFFFAOYSA-M |
| Roles Classification |
|---|
| Biological Role: | plant metabolite Any eukaryotic metabolite produced during a metabolic reaction in plants, the kingdom that include flowering plants, conifers and other gymnosperms. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 4-oxopentanoate (CHEBI:39150) has role plant metabolite (CHEBI:76924) |
| 4-oxopentanoate (CHEBI:39150) is a oxopentanoates (CHEBI:25798) |
| 4-oxopentanoate (CHEBI:39150) is conjugate base of 4-oxopentanoic acid (CHEBI:45630) |
| Incoming Relation(s) |
| 5-aminolevulinate (CHEBI:12109) has functional parent 4-oxopentanoate (CHEBI:39150) |
| 4-oxopentanoic acid (CHEBI:45630) is conjugate acid of 4-oxopentanoate (CHEBI:39150) |
| IUPAC Name |
|---|
| 4-oxopentanoate |
| Synonyms | Source |
|---|---|
| 4-oxovalerate | ChEBI |
| laevulinate | ChEBI |
| 4-ketovalerate | ChEBI |
| levulinate | ChEBI |
| levulate | ChEBI |
| 3-acetylpropionate | ChEBI |
| UniProt Name | Source |
|---|---|
| 4-oxopentanoate | UniProt |
| Manual Xrefs | Databases |
|---|---|
| CPD-16942 | MetaCyc |
| Registry Numbers | Sources |
|---|---|
| Gmelin:325844 | Gmelin |
| Reaxys:3537533 | Reaxys |