EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C5H9NO3 |
| Net Charge | 0 |
| Average Mass | 131.131 |
| Monoisotopic Mass | 131.05824 |
| SMILES | NCC(=O)CCC(=O)O |
| InChI | InChI=1S/C5H9NO3/c6-3-4(7)1-2-5(8)9/h1-3,6H2,(H,8,9) |
| InChIKey | ZGXJTSGNIOSYLO-UHFFFAOYSA-N |
| Wikipedia |
|---|
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Escherichia coli (ncbitaxon:562) | - | PubMed (21988831) | |
| Homo sapiens (ncbitaxon:9606) | - | DOI (10.1038/nbt.2488) | |
| Mus musculus (ncbitaxon:10090) | - | PubMed (19425150) | Source: BioModels - MODEL1507180067 |
| Saccharomyces cerevisiae (ncbitaxon:4932) | - | PubMed (24678285) | Source: yeast.sf.net |
| Roles Classification |
|---|
| Chemical Roles: | Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| Biological Roles: | mouse metabolite Any mammalian metabolite produced during a metabolic reaction in a mouse (Mus musculus). Saccharomyces cerevisiae metabolite Any fungal metabolite produced during a metabolic reaction in Baker's yeast (Saccharomyces cerevisiae ). plant metabolite Any eukaryotic metabolite produced during a metabolic reaction in plants, the kingdom that include flowering plants, conifers and other gymnosperms. Escherichia coli metabolite Any bacterial metabolite produced during a metabolic reaction in Escherichia coli. human metabolite Any mammalian metabolite produced during a metabolic reaction in humans (Homo sapiens). |
| Applications: | photosensitizing agent A chemical compound that can be excited by light of a specific wavelength and subsequently transfer energy to a chosen reactant. This is commonly molecular oxygen within a cancer tissue, which is converted to (highly rective) singlet state oxygen. This rapidly reacts with any nearby biomolecules, ultimately killing the cancer cells. prodrug A compound that, on administration, must undergo chemical conversion by metabolic processes before becoming the pharmacologically active drug for which it is a prodrug. dermatologic drug A drug used to treat or prevent skin disorders or for the routine care of skin. antineoplastic agent A substance that inhibits or prevents the proliferation of neoplasms. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 5-aminolevulinic acid (CHEBI:17549) has functional parent 4-oxopentanoic acid (CHEBI:45630) |
| 5-aminolevulinic acid (CHEBI:17549) has role Escherichia coli metabolite (CHEBI:76971) |
| 5-aminolevulinic acid (CHEBI:17549) has role Saccharomyces cerevisiae metabolite (CHEBI:75772) |
| 5-aminolevulinic acid (CHEBI:17549) has role antineoplastic agent (CHEBI:35610) |
| 5-aminolevulinic acid (CHEBI:17549) has role dermatologic drug (CHEBI:50177) |
| 5-aminolevulinic acid (CHEBI:17549) has role human metabolite (CHEBI:77746) |
| 5-aminolevulinic acid (CHEBI:17549) has role mouse metabolite (CHEBI:75771) |
| 5-aminolevulinic acid (CHEBI:17549) has role photosensitizing agent (CHEBI:47868) |
| 5-aminolevulinic acid (CHEBI:17549) has role plant metabolite (CHEBI:76924) |
| 5-aminolevulinic acid (CHEBI:17549) has role prodrug (CHEBI:50266) |
| 5-aminolevulinic acid (CHEBI:17549) is a 4-oxo monocarboxylic acid (CHEBI:35950) |
| 5-aminolevulinic acid (CHEBI:17549) is a δ-amino acid (CHEBI:35931) |
| 5-aminolevulinic acid (CHEBI:17549) is conjugate acid of 5-aminolevulinate (CHEBI:12109) |
| 5-aminolevulinic acid (CHEBI:17549) is conjugate base of 5-ammoniolevulinic acid (CHEBI:132970) |
| 5-aminolevulinic acid (CHEBI:17549) is tautomer of 5-ammoniolevulinate (CHEBI:356416) |
| Incoming Relation(s) |
| methyl 5-aminolevulinate (CHEBI:724125) has functional parent 5-aminolevulinic acid (CHEBI:17549) |
| 5-ammoniolevulinic acid (CHEBI:132970) is conjugate acid of 5-aminolevulinic acid (CHEBI:17549) |
| 5-aminolevulinate (CHEBI:12109) is conjugate base of 5-aminolevulinic acid (CHEBI:17549) |
| 5-ammoniolevulinate (CHEBI:356416) is tautomer of 5-aminolevulinic acid (CHEBI:17549) |
| IUPAC Name |
|---|
| 5-amino-4-oxopentanoic acid |
| Synonyms | Source |
|---|---|
| 5-ALA | ChEBI |
| 5-Amino-4-oxopentanoate | KEGG COMPOUND |
| 5-Amino-4-oxovaleric acid | KEGG COMPOUND |
| 5-Aminolevulinate | KEGG COMPOUND |
| aminolevulinic acid | ChemIDplus |
| dALA | ChEBI |
| Manual Xrefs | Databases |
|---|---|
| 166 | DrugCentral |
| Aminolevulinic_acid | Wikipedia |
| C00007378 | KNApSAcK |
| C00430 | KEGG COMPOUND |
| D07567 | KEGG DRUG |
| DB00855 | DrugBank |
| HMDB0001149 | HMDB |
| LSM-5677 | LINCS |
| Registry Numbers | Sources |
|---|---|
| Reaxys:1759139 | Reaxys |
| CAS:106-60-5 | KEGG COMPOUND |
| CAS:106-60-5 | ChemIDplus |
| Citations |
|---|