EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C8H11N4O8P |
| Net Charge | -2 |
| Average Mass | 322.170 |
| Monoisotopic Mass | 322.03255 |
| SMILES | NC(=O)c1ncn([C@@H]2O[C@H](COP(=O)([O-])[O-])[C@@H](O)[C@H]2O)n1 |
| InChI | InChI=1S/C8H13N4O8P/c9-6(15)7-10-2-12(11-7)8-5(14)4(13)3(20-8)1-19-21(16,17)18/h2-5,8,13-14H,1H2,(H2,9,15)(H2,16,17,18)/p-2/t3-,4-,5-,8-/m1/s1 |
| InChIKey | SDWIOXKHTFOULX-AFCXAGJDSA-L |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| ribavirin 5'-monophosphate(2−) (CHEBI:189091) is a organophosphate oxoanion (CHEBI:58945) |
| ribavirin 5'-monophosphate(2−) (CHEBI:189091) is conjugate base of ribavirin 5'-monophosphate (CHEBI:45490) |
| Incoming Relation(s) |
| ribavirin 5'-monophosphate (CHEBI:45490) is conjugate acid of ribavirin 5'-monophosphate(2−) (CHEBI:189091) |
| IUPAC Name |
|---|
| 1-(5-O-phosphonato-β-D-ribofuranosyl)-1H-1,2,4-triazole-3-carboxamide |