EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C13H19NO |
| Net Charge | 0 |
| Average Mass | 205.301 |
| Monoisotopic Mass | 205.14666 |
| SMILES | CCN(CC)C(C)C(=O)c1ccccc1 |
| InChI | InChI=1S/C13H19NO/c1-4-14(5-2)11(3)13(15)12-9-7-6-8-10-12/h6-11H,4-5H2,1-3H3 |
| InChIKey | XXEPPPIWZFICOJ-UHFFFAOYSA-N |
| Wikipedia |
|---|
| Roles Classification |
|---|
| Chemical Role: | Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). |
| Biological Role: | anti-obesity agent Any substance which is used to reduce or control weight. |
| Application: | appetite depressant Any agent that is used to decrease appetite. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| diethylpropion (CHEBI:4530) has functional parent propiophenone (CHEBI:425902) |
| diethylpropion (CHEBI:4530) has role anti-obesity agent (CHEBI:74518) |
| diethylpropion (CHEBI:4530) has role appetite depressant (CHEBI:50507) |
| diethylpropion (CHEBI:4530) is a aromatic ketone (CHEBI:76224) |
| diethylpropion (CHEBI:4530) is a tertiary amine (CHEBI:32876) |
| Incoming Relation(s) |
| diethylpropion hydrochloride (CHEBI:643703) has part diethylpropion (CHEBI:4530) |
| (R)-diethylpropion (CHEBI:59746) is a diethylpropion (CHEBI:4530) |
| (S)-diethylpropion (CHEBI:59747) is a diethylpropion (CHEBI:4530) |
| IUPAC Name |
|---|
| 2-(diethylamino)-1-phenylpropan-1-one |
| INNs | Source |
|---|---|
| amfepramone | ChemIDplus |
| amfépramone | WHO MedNet |
| amfepramonum | ChemIDplus |
| anfepramona | ChemIDplus |
| Synonyms | Source |
|---|---|
| 1-phenyl-2-diethylamino-1-propanone | ChemIDplus |
| 2-(diethylamino)-1-phenyl-1-propanone | ChemIDplus |
| 2-(diethylamino)propiophenone | ChemIDplus |
| .alpha.-benzoyltriethylamine | ChEMBL |
| Amfepramone | KEGG COMPOUND |
| Anfepramone | ChEMBL |
| Manual Xrefs | Databases |
|---|---|
| 874 | DrugCentral |
| C06954 | KEGG COMPOUND |
| D07444 | KEGG DRUG |
| DB00937 | DrugBank |
| Diethylpropion | Wikipedia |
| HMDB0015072 | HMDB |
| LSM-5038 | LINCS |
| US3001910 | Patent |
| Citations |
|---|