EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C13H19NO |
| Net Charge | 0 |
| Average Mass | 205.301 |
| Monoisotopic Mass | 205.14666 |
| SMILES | CCN(CC)[C@H](C)C(=O)c1ccccc1 |
| InChI | InChI=1S/C13H19NO/c1-4-14(5-2)11(3)13(15)12-9-7-6-8-10-12/h6-11H,4-5H2,1-3H3/t11-/m1/s1 |
| InChIKey | XXEPPPIWZFICOJ-LLVKDONJSA-N |
| Roles Classification |
|---|
| Chemical Roles: | Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). |
| Application: | appetite depressant Any agent that is used to decrease appetite. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| (R)-diethylpropion (CHEBI:59746) is a diethylpropion (CHEBI:4530) |
| (R)-diethylpropion (CHEBI:59746) is enantiomer of (S)-diethylpropion (CHEBI:59747) |
| Incoming Relation(s) |
| (S)-diethylpropion (CHEBI:59747) is enantiomer of (R)-diethylpropion (CHEBI:59746) |
| IUPAC Name |
|---|
| (2R)-2-(diethylamino)-1-phenylpropan-1-one |
| Synonyms | Source |
|---|---|
| (2R)-diethylpropion | ChEBI |
| (R)-amfepramone | ChEBI |
| (R)-α-benzoyltriethylamine | ChEBI |
| (R)-α-diethylaminopropiophenone | ChEBI |