EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C13H20NO.Cl |
| Net Charge | 0 |
| Average Mass | 241.762 |
| Monoisotopic Mass | 241.12334 |
| SMILES | CC[NH+](CC)C(C)C(=O)c1ccccc1.[Cl-] |
| InChI | InChI=1S/C13H19NO.ClH/c1-4-14(5-2)11(3)13(15)12-9-7-6-8-10-12;/h6-11H,4-5H2,1-3H3;1H |
| InChIKey | ICFXZZFWRWNZMA-UHFFFAOYSA-N |
| Roles Classification |
|---|
| Biological Role: | anti-obesity agent Any substance which is used to reduce or control weight. |
| Application: | appetite depressant Any agent that is used to decrease appetite. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| diethylpropion hydrochloride (CHEBI:643703) has part diethylpropion (CHEBI:4530) |
| diethylpropion hydrochloride (CHEBI:643703) has role anti-obesity agent (CHEBI:74518) |
| diethylpropion hydrochloride (CHEBI:643703) has role appetite depressant (CHEBI:50507) |
| diethylpropion hydrochloride (CHEBI:643703) is a hydrochloride (CHEBI:36807) |
| IUPAC Name |
|---|
| N,N-diethyl-1-oxo-1-phenylpropan-2-aminium chloride |
| Synonyms | Source |
|---|---|
| 2-(diethylamino)-1-phenylpropan-1-one hydrochloride | IUPAC |
| 2-(diethylamino)propiophenone hydrochloride | ChemIDplus |
| amfepramone HCl | ChEBI |
| amfepramone hydrochloride | ChemIDplus |
| amphepramonum hydrochloride | ChemIDplus |
| Anorex | ChEMBL |
| Brand Names | Source |
|---|---|
| Apisate | ChEMBL |
| Tenuate dospan | ChEMBL |
| Tepanil | ChEMBL |
| Tepanil ten-tab | ChEMBL |
| Citations |
|---|