EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C18H25NO |
| Net Charge | 0 |
| Average Mass | 271.404 |
| Monoisotopic Mass | 271.19361 |
| SMILES | [H][C@]12CCCC[C@]13CCN(C)[C@H]2Cc1ccc(OC)cc13 |
| InChI | InChI=1S/C18H25NO/c1-19-10-9-18-8-4-3-5-15(18)17(19)11-13-6-7-14(20-2)12-16(13)18/h6-7,12,15,17H,3-5,8-11H2,1-2H3/t15-,17+,18+/m1/s1 |
| InChIKey | MKXZASYAUGDDCJ-NJAFHUGGSA-N |
| Wikipedia |
|---|
| Roles Classification |
|---|
| Chemical Role: | environmental contaminant Any minor or unwanted substance introduced into the environment that can have undesired effects. |
| Biological Roles: | xenobiotic A xenobiotic (Greek, xenos "foreign"; bios "life") is a compound that is foreign to a living organism. Principal xenobiotics include: drugs, carcinogens and various compounds that have been introduced into the environment by artificial means. neurotoxin A poison that interferes with the functions of the nervous system. NMDA receptor antagonist Any substance that inhibits the action of N-methyl-D-aspartate (NMDA) receptors. They tend to induce a state known as dissociative anesthesia, marked by catalepsy, amnesia, and analgesia, while side effects can include hallucinations, nightmares, and confusion. Due to their psychotomimetic effects, many NMDA receptor antagonists are used as recreational drugs. metabolite Any intermediate or product resulting from metabolism. The term 'metabolite' subsumes the classes commonly known as primary and secondary metabolites. |
| Applications: | antitussive An agent that suppresses cough. Antitussives have a central or a peripheral action on the cough reflex, or a combination of both. Compare with expectorants, which are considered to increase the volume of secretions in the respiratory tract, so facilitating their removal by ciliary action and coughing, and mucolytics, which decrease the viscosity of mucus, facilitating its removal by ciliary action and expectoration. oneirogen Any substance that produces or enhances dream-like states of consciousness. prodrug A compound that, on administration, must undergo chemical conversion by metabolic processes before becoming the pharmacologically active drug for which it is a prodrug. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| dextromethorphan (CHEBI:4470) has functional parent dextrorphan (CHEBI:29133) |
| dextromethorphan (CHEBI:4470) has role antitussive (CHEBI:51177) |
| dextromethorphan (CHEBI:4470) has role environmental contaminant (CHEBI:78298) |
| dextromethorphan (CHEBI:4470) has role neurotoxin (CHEBI:50910) |
| dextromethorphan (CHEBI:4470) has role NMDA receptor antagonist (CHEBI:60643) |
| dextromethorphan (CHEBI:4470) has role oneirogen (CHEBI:146270) |
| dextromethorphan (CHEBI:4470) has role prodrug (CHEBI:50266) |
| dextromethorphan (CHEBI:4470) has role xenobiotic (CHEBI:35703) |
| dextromethorphan (CHEBI:4470) is a 6-methoxy-11-methyl-1,3,4,9,10,10a-hexahydro-2H-10,4a-(epiminoethano)phenanthrene (CHEBI:146178) |
| dextromethorphan (CHEBI:4470) is enantiomer of levomethorphan (CHEBI:146176) |
| Incoming Relation(s) |
| dextromethorphan hydrobromide (CHEBI:4471) has part dextromethorphan (CHEBI:4470) |
| racemethorphan (CHEBI:146177) has part dextromethorphan (CHEBI:4470) |
| levomethorphan (CHEBI:146176) is enantiomer of dextromethorphan (CHEBI:4470) |
| IUPAC Names |
|---|
| 3-methoxy-17-methyl-9α,13α,14α-morphinan |
| (4aS,10S,10aS)-6-methoxy-11-methyl-1,3,4,9,10,10a-hexahydro-2H-10,4a-(epiminoethano)phenanthrene |
| INNs | Source |
|---|---|
| dextromethorphan | WHO MedNet |
| dextrometorfano | WHO MedNet |
| dextromethorphanum | WHO MedNet |
| dextrométhorphane | WHO MedNet |
| Synonyms | Source |
|---|---|
| D-methorphan | NIST Chemistry WebBook |
| DXM | ChemIDplus |
| dextromethorfan | ChemIDplus |
| destrometerfano | ChemIDplus |
| d-Methorphan | DrugCentral |
| (+)-dextromethorphan | DrugCentral |
| Brand Names | Source |
|---|---|
| Dextromorphan | ChemIDplus |
| Romilar | NIST Chemistry WebBook |
| Benylin DM | HMDB |
| Albutussin | ChemIDplus |
| Delsym | NIST Chemistry WebBook |
| Medicon | NIST Chemistry WebBook |
| Manual Xrefs | Databases |
|---|---|
| C06947 | KEGG COMPOUND |
| DB00514 | DrugBank |
| D03742 | KEGG DRUG |
| Dextromethorphan | Wikipedia |
| HMDB0001920 | HMDB |
| LSM-2726 | LINCS |
| 842 | DrugCentral |
| Citations |
|---|