EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C17H23NO |
| Net Charge | 0 |
| Average Mass | 257.377 |
| Monoisotopic Mass | 257.17796 |
| SMILES | [H][C@]12CCCC[C@]13CCN(C)[C@H]2Cc1ccc(O)cc13 |
| InChI | InChI=1S/C17H23NO/c1-18-9-8-17-7-3-2-4-14(17)16(18)10-12-5-6-13(19)11-15(12)17/h5-6,11,14,16,19H,2-4,7-10H2,1H3/t14-,16+,17+/m1/s1 |
| InChIKey | JAQUASYNZVUNQP-PVAVHDDUSA-N |
| Roles Classification |
|---|
| Biological Role: | metabolite Any intermediate or product resulting from metabolism. The term 'metabolite' subsumes the classes commonly known as primary and secondary metabolites. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| dextrorphan (CHEBI:29133) is a morphinane alkaloid (CHEBI:25418) |
| Incoming Relation(s) |
| dextromethorphan (CHEBI:4470) has functional parent dextrorphan (CHEBI:29133) |
| dextrorphan O-glucosiduronic acid (CHEBI:32645) has functional parent dextrorphan (CHEBI:29133) |
| IUPAC Name |
|---|
| 17-methyl-9α,13α,14α-morphinan-3-ol |
| INNs | Source |
|---|---|
| dextrorphan | ChemIDplus |
| dextrorphane | ChemIDplus |
| dextrorphanum | ChemIDplus |
| Synonyms | Source |
|---|---|
| (+)-3-hydroxy-N-methylmorphinan | ChemIDplus |
| d-3-hydroxy-N-methylmorphinan | ChemIDplus |