EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
CHEBI:146176 - levomethorphan
| Formula | C18H25NO |
| Net Charge | 0 |
| Average Mass | 271.404 |
| Monoisotopic Mass | 271.19361 |
| SMILES | [H][C@@]12CCCC[C@@]13CCN(C)[C@@H]2Cc1ccc(OC)cc13 |
| InChI | InChI=1S/C18H25NO/c1-19-10-9-18-8-4-3-5-15(18)17(19)11-13-6-7-14(20-2)12-16(13)18/h6-7,12,15,17H,3-5,8-11H2,1-2H3/t15-,17+,18+/m0/s1 |
| InChIKey | MKXZASYAUGDDCJ-CGTJXYLNSA-N |
| Wikipedia |
|---|
| Roles Classification |
|---|
| Biological Roles: | opioid analgesic A narcotic or opioid substance, synthetic or semisynthetic agent producing profound analgesia, drowsiness, and changes in mood. metabolite Any intermediate or product resulting from metabolism. The term 'metabolite' subsumes the classes commonly known as primary and secondary metabolites. |
| Applications: | prodrug A compound that, on administration, must undergo chemical conversion by metabolic processes before becoming the pharmacologically active drug for which it is a prodrug. opioid analgesic A narcotic or opioid substance, synthetic or semisynthetic agent producing profound analgesia, drowsiness, and changes in mood. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| levomethorphan (CHEBI:146176) has functional parent Levorphanol (CHEBI:6444) |
| levomethorphan (CHEBI:146176) has role opioid analgesic (CHEBI:35482) |
| levomethorphan (CHEBI:146176) has role prodrug (CHEBI:50266) |
| levomethorphan (CHEBI:146176) is a 6-methoxy-11-methyl-1,3,4,9,10,10a-hexahydro-2H-10,4a-(epiminoethano)phenanthrene (CHEBI:146178) |
| levomethorphan (CHEBI:146176) is enantiomer of dextromethorphan (CHEBI:4470) |
| Incoming Relation(s) |
| racemethorphan (CHEBI:146177) has part levomethorphan (CHEBI:146176) |
| dextromethorphan (CHEBI:4470) is enantiomer of levomethorphan (CHEBI:146176) |
| IUPAC Names |
|---|
| 3-methoxy-17-methylmorphinan |
| (4aR,10R,10aR)-6-methoxy-11-methyl-1,3,4,9,10,10a-hexahydro-2H-10,4a-(epiminoethano)phenanthrene |
| INNs | Source |
|---|---|
| levomethorphan | WHO MedNet |
| lévométhorphane | WHO MedNet |
| levomethorphanum | WHO MedNet |
| levometorfano | WHO MedNet |
| Synonyms | Source |
|---|---|
| (−)-3-methoxy-17-methylmorphinan | ChEBI |
| (−)-3-methoxy-N-methylmorphinan | ChemIDplus |
| L-3-methoxy-17-methylmorphinan | ChEBI |
| L-methorphan | ChemIDplus |
| Manual Xrefs | Databases |
|---|---|
| Levomethorphan | Wikipedia |
| Citations |
|---|