EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C5H11NO2 |
| Net Charge | 0 |
| Average Mass | 117.148 |
| Monoisotopic Mass | 117.07898 |
| SMILES | CCC[C@H](N)C(=O)O |
| InChI | InChI=1S/C5H11NO2/c1-2-3-4(6)5(7)8/h4H,2-3,6H2,1H3,(H,7,8)/t4-/m0/s1 |
| InChIKey | SNDPXSYFESPGGJ-BYPYZUCNSA-N |
| Wikipedia |
|---|
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Daphnia pulex (ncbitaxon:6669) | - | MetaboLights (MTBLS259) | From MetaboLights |
| Pseudomonas putida (ncbitaxon:303) | - | MetaboLights (MTBLS320) | From MetaboLights |
| Serratia marcescens (ncbitaxon:615) | - | PubMed (783153) |
| Roles Classification |
|---|
| Chemical Roles: | Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| Biological Role: | bacterial metabolite Any prokaryotic metabolite produced during a metabolic reaction in bacteria. |
| Applications: | neuroprotective agent Any compound that can be used for the treatment of neurodegenerative disorders. hypoglycemic agent A drug which lowers the blood glucose level. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| L-2-aminopentanoic acid (CHEBI:18314) has role bacterial metabolite (CHEBI:76969) |
| L-2-aminopentanoic acid (CHEBI:18314) has role hypoglycemic agent (CHEBI:35526) |
| L-2-aminopentanoic acid (CHEBI:18314) has role neuroprotective agent (CHEBI:63726) |
| L-2-aminopentanoic acid (CHEBI:18314) is a 2-aminopentanoic acid (CHEBI:19475) |
| L-2-aminopentanoic acid (CHEBI:18314) is enantiomer of D-2-aminopentanoic acid (CHEBI:28804) |
| L-2-aminopentanoic acid (CHEBI:18314) is tautomer of L-2-aminopentanoic acid zwitterion (CHEBI:58441) |
| Incoming Relation(s) |
| D-2-aminopentanoic acid (CHEBI:28804) is enantiomer of L-2-aminopentanoic acid (CHEBI:18314) |
| L-2-aminopentanoic acid zwitterion (CHEBI:58441) is tautomer of L-2-aminopentanoic acid (CHEBI:18314) |
| IUPAC Name |
|---|
| (2S)-2-aminopentanoic acid |
| Synonyms | Source |
|---|---|
| L-2-aminopentanoic acid | ChEBI |
| L-2-Aminopentanoic acid | KEGG COMPOUND |
| L-2-aminovaleric acid | ChEBI |
| L-2-Aminovaleric acid | KEGG COMPOUND |
| L-norvaline | ChEBI |
| L-Norvaline | KEGG COMPOUND |
| Manual Xrefs | Databases |
|---|---|
| C01826 | KEGG COMPOUND |
| C01826 | KEGG COMPOUND |
| L-2-AMINOPENTANOIC-ACID | MetaCyc |
| LMFA01100041 | LIPID MAPS |
| Norvaline | Wikipedia |
| NVA | PDBeChem |
| Citations |
|---|