EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C5H11NO2 |
| Net Charge | 0 |
| Average Mass | 117.148 |
| Monoisotopic Mass | 117.07898 |
| SMILES | CCC[C@H]([NH3+])C(=O)[O-] |
| InChI | InChI=1S/C5H11NO2/c1-2-3-4(6)5(7)8/h4H,2-3,6H2,1H3,(H,7,8)/t4-/m0/s1 |
| InChIKey | SNDPXSYFESPGGJ-BYPYZUCNSA-N |
| Roles Classification |
|---|
| Biological Role: | bacterial metabolite Any prokaryotic metabolite produced during a metabolic reaction in bacteria. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| L-2-aminopentanoic acid zwitterion (CHEBI:58441) has role bacterial metabolite (CHEBI:76969) |
| L-2-aminopentanoic acid zwitterion (CHEBI:58441) is a L-α-amino acid zwitterion (CHEBI:59869) |
| L-2-aminopentanoic acid zwitterion (CHEBI:58441) is tautomer of L-2-aminopentanoic acid (CHEBI:18314) |
| Incoming Relation(s) |
| L-2-aminopentanoic acid (CHEBI:18314) is tautomer of L-2-aminopentanoic acid zwitterion (CHEBI:58441) |
| IUPAC Name |
|---|
| (2S)-2-ammoniopentanoate |
| UniProt Name | Source |
|---|---|
| L-2-aminopentanoate | UniProt |
| Manual Xrefs | Databases |
|---|---|
| L-2-AMINOPENTANOIC-ACID | MetaCyc |