EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C5H11NO2 |
| Net Charge | 0 |
| Average Mass | 117.148 |
| Monoisotopic Mass | 117.07898 |
| SMILES | CCCC(N)C(=O)O |
| InChI | InChI=1S/C5H11NO2/c1-2-3-4(6)5(7)8/h4H,2-3,6H2,1H3,(H,7,8) |
| InChIKey | SNDPXSYFESPGGJ-UHFFFAOYSA-N |
| Wikipedia |
|---|
| Roles Classification |
|---|
| Chemical Roles: | Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 2-aminopentanoic acid (CHEBI:19475) has functional parent valeric acid (CHEBI:17418) |
| 2-aminopentanoic acid (CHEBI:19475) is a non-proteinogenic α-amino acid (CHEBI:83925) |
| Incoming Relation(s) |
| 2-amino-5-phosphonopentanoic acid (CHEBI:138644) has functional parent 2-aminopentanoic acid (CHEBI:19475) |
| 3-hydroxynorvaline (CHEBI:74112) has functional parent 2-aminopentanoic acid (CHEBI:19475) |
| D-2-aminopentanoic acid (CHEBI:28804) is a 2-aminopentanoic acid (CHEBI:19475) |
| L-2-aminopentanoic acid (CHEBI:18314) is a 2-aminopentanoic acid (CHEBI:19475) |
| IUPAC Name |
|---|
| norvaline |
| Synonyms | Source |
|---|---|
| 2-aminopentanoic acids | ChEBI |
| 2-aminovaleric acids | ChEBI |
| 2-Aminovaleric acid | ChemIDplus |
| α-aminovaleric acid | ChemIDplus |
| α-aminopentanoic acid | ChemIDplus |
| norvalines | ChEBI |