EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C5H11NO2 |
| Net Charge | 0 |
| Average Mass | 117.148 |
| Monoisotopic Mass | 117.07898 |
| SMILES | CCC[C@@H](N)C(=O)O |
| InChI | InChI=1S/C5H11NO2/c1-2-3-4(6)5(7)8/h4H,2-3,6H2,1H3,(H,7,8)/t4-/m1/s1 |
| InChIKey | SNDPXSYFESPGGJ-SCSAIBSYSA-N |
| Roles Classification |
|---|
| Chemical Roles: | Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| Biological Role: | EC 6.1.1.4 (leucine--tRNA ligase) inhibitor An EC 6.1.1.* (ligases forming aminoacyl tRNA and related compounds) inhibitor that inhibits the action of leucine—tRNA synthetase (EC 6.1.1.4). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| D-2-aminopentanoic acid (CHEBI:28804) has role EC 6.1.1.4 (leucine—tRNA ligase) inhibitor (CHEBI:77953) |
| D-2-aminopentanoic acid (CHEBI:28804) is a D-α-amino acid (CHEBI:16733) |
| D-2-aminopentanoic acid (CHEBI:28804) is a 2-aminopentanoic acid (CHEBI:19475) |
| D-2-aminopentanoic acid (CHEBI:28804) is enantiomer of L-2-aminopentanoic acid (CHEBI:18314) |
| Incoming Relation(s) |
| L-2-aminopentanoic acid (CHEBI:18314) is enantiomer of D-2-aminopentanoic acid (CHEBI:28804) |
| IUPAC Name |
|---|
| (2R)-2-aminopentanoic acid |
| Synonyms | Source |
|---|---|
| D-2-Aminopentanoic acid | KEGG COMPOUND |
| D-2-Aminovaleric acid | KEGG COMPOUND |
| D-Norvaline | KEGG COMPOUND |
| (R)-norvaline | ChEBI |
| D-Ape | JCBN |
| D-Nva | ChEBI |
| Manual Xrefs | Databases |
|---|---|
| C01799 | KEGG COMPOUND |
| CN101007774 | Patent |
| Registry Numbers | Sources |
|---|---|
| Reaxys:1721161 | Reaxys |
| CAS:2013-12-9 | KEGG COMPOUND |
| CAS:2013-12-9 | ChemIDplus |
| Citations |
|---|