EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
CHEBI:43991 - malonamic acid
| Formula | C3H5NO3 |
| Net Charge | 0 |
| Average Mass | 103.077 |
| Monoisotopic Mass | 103.02694 |
| SMILES | NC(=O)CC(=O)O |
| InChI | InChI=1S/C3H5NO3/c4-2(5)1-3(6)7/h1H2,(H2,4,5)(H,6,7) |
| InChIKey | CGJMROBVSBIBKP-UHFFFAOYSA-N |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| malonamic acid (CHEBI:43991) is a β-alanine derivative (CHEBI:22823) |
| malonamic acid (CHEBI:43991) is conjugate acid of malonamate (CHEBI:49102) |
| Incoming Relation(s) |
| N-(2-hydroxyphenyl)malonamic acid (CHEBI:195238) has functional parent malonamic acid (CHEBI:43991) |
| N-(3,4-dichlorophenyl)malonamic acid (CHEBI:49101) has functional parent malonamic acid (CHEBI:43991) |
| malonamoyl-CoA (CHEBI:28334) has functional parent malonamic acid (CHEBI:43991) |
| malonamate (CHEBI:49102) is conjugate base of malonamic acid (CHEBI:43991) |
| IUPAC Name |
|---|
| 3-amino-3-oxopropanoic acid |
| Synonym | Source |
|---|---|
| malonamic acid | ChemIDplus |