EMBL-EBI | Chemical Biology Resources | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C3H4NO3 |
| Net Charge | -1 |
| Average Mass | 102.069 |
| Monoisotopic Mass | 102.01967 |
| SMILES | NC(=O)CC(=O)[O-] |
| InChI | InChI=1S/C3H5NO3/c4-2(5)1-3(6)7/h1H2,(H2,4,5)(H,6,7)/p-1 |
| InChIKey | CGJMROBVSBIBKP-UHFFFAOYSA-M |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| malonamate (CHEBI:49102) is a β-amino-acid anion (CHEBI:49095) |
| malonamate (CHEBI:49102) is conjugate base of malonamic acid (CHEBI:43991) |
| Incoming Relation(s) |
| N-(2-hydroxy,5-methoxyphenyl)malonamate (CHEBI:195242) has functional parent malonamate (CHEBI:49102) |
| N-(2-hydroxyphenyl)malonamate (CHEBI:195239) has functional parent malonamate (CHEBI:49102) |
| N-(3,4-dichlorophenyl)malonamate (CHEBI:17318) has functional parent malonamate (CHEBI:49102) |
| malonamic acid (CHEBI:43991) is conjugate acid of malonamate (CHEBI:49102) |
| IUPAC Name |
|---|
| 3-amino-3-oxopropanoate |