EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C9H7Cl2NO3 |
| Net Charge | 0 |
| Average Mass | 248.065 |
| Monoisotopic Mass | 246.98030 |
| SMILES | O=C(O)CC(=O)Nc1ccc(Cl)c(Cl)c1 |
| InChI | InChI=1S/C9H7Cl2NO3/c10-6-2-1-5(3-7(6)11)12-8(13)4-9(14)15/h1-3H,4H2,(H,12,13)(H,14,15) |
| InChIKey | JEFJREKVJYACNK-UHFFFAOYSA-N |
| Roles Classification |
|---|
| Chemical Role: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| N-(3,4-dichlorophenyl)malonamic acid (CHEBI:49101) has functional parent malonamic acid (CHEBI:43991) |
| N-(3,4-dichlorophenyl)malonamic acid (CHEBI:49101) is a dicarboxylic acid monoamide (CHEBI:35735) |
| N-(3,4-dichlorophenyl)malonamic acid (CHEBI:49101) is a dichlorobenzene (CHEBI:23697) |
| N-(3,4-dichlorophenyl)malonamic acid (CHEBI:49101) is a monocarboxylic acid (CHEBI:25384) |
| N-(3,4-dichlorophenyl)malonamic acid (CHEBI:49101) is conjugate acid of N-(3,4-dichlorophenyl)malonamate (CHEBI:17318) |
| Incoming Relation(s) |
| N-(3,4-dichlorophenyl)malonamate (CHEBI:17318) is conjugate base of N-(3,4-dichlorophenyl)malonamic acid (CHEBI:49101) |
| IUPAC Name |
|---|
| 3-[(3,4-dichlorophenyl)amino]-3-oxopropanoic acid |
| Manual Xrefs | Databases |
|---|---|
| C04205 | KEGG COMPOUND |
| Registry Numbers | Sources |
|---|---|
| Reaxys:2811204 | Reaxys |
| CAS:17722-36-0 | ChemIDplus |