EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
CHEBI:43968 - meropenem
| Formula | C17H25N3O5S |
| Net Charge | 0 |
| Average Mass | 383.470 |
| Monoisotopic Mass | 383.15149 |
| SMILES | [H][C@]12[C@@H](C)C(S[C@@H]3CN[C@H](C(=O)N(C)C)C3)=C(C(=O)O)N1C(=O)[C@]2([H])[C@@H](C)O |
| InChI | InChI=1S/C17H25N3O5S/c1-7-12-11(8(2)21)16(23)20(12)13(17(24)25)14(7)26-9-5-10(18-6-9)15(22)19(3)4/h7-12,18,21H,5-6H2,1-4H3,(H,24,25)/t7-,8-,9+,10+,11-,12-/m1/s1 |
| InChIKey | DMJNNHOOLUXYBV-PQTSNVLCSA-N |
| Wikipedia |
|---|
| Roles Classification |
|---|
| Chemical Role: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| Biological Roles: | drug allergen Any drug which causes the onset of an allergic reaction. antibacterial drug A drug used to treat or prevent bacterial infections. antibacterial agent A substance (or active part thereof) that kills or slows the growth of bacteria. antibacterial agent A substance (or active part thereof) that kills or slows the growth of bacteria. antimicrobial agent A substance that kills or slows the growth of microorganisms, including bacteria, viruses, fungi and protozoans. antimicrobial agent A substance that kills or slows the growth of microorganisms, including bacteria, viruses, fungi and protozoans. |
| Applications: | drug allergen Any drug which causes the onset of an allergic reaction. antibacterial drug A drug used to treat or prevent bacterial infections. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| meropenem (CHEBI:43968) has role antibacterial agent (CHEBI:33282) |
| meropenem (CHEBI:43968) has role antibacterial drug (CHEBI:36047) |
| meropenem (CHEBI:43968) has role drug allergen (CHEBI:88188) |
| meropenem (CHEBI:43968) is a carbapenemcarboxylic acid (CHEBI:46634) |
| meropenem (CHEBI:43968) is a organic sulfide (CHEBI:16385) |
| meropenem (CHEBI:43968) is a pyrrolidinecarboxamide (CHEBI:46770) |
| meropenem (CHEBI:43968) is a α,β-unsaturated monocarboxylic acid (CHEBI:79020) |
| Incoming Relation(s) |
| meropenem trihydrate (CHEBI:6770) has part meropenem (CHEBI:43968) |
| IUPAC Name |
|---|
| (6S)-2-{[(3S,5S)-5-(dimethylcarbamoyl)pyrrolidin-3-yl]sulfanyl}-6-[(1R)-1-hydroxyethyl]-1β-methyl-2,3-didehydro-1-carbapenam-3-carboxylic acid |
| INNs | Source |
|---|---|
| meropenem | ChEBI |
| meropenemum | DrugBank |
| Synonyms | Source |
|---|---|
| (1R,5S,6S)-2-[(3S,5S)-5-DIMETHYLAMINOCARBONYLPYRROLIDIN-3-YLTHIO]-6-[(R)-1-HYDROXYETHYL]-1-METHYLCARBAPEN-2-EM-3-CARBOXYLIC ACID | PDBeChem |
| (4R,5S,6S)-3-{[(3S,5S)-5-(dimethylcarbamoyl)pyrrolidin-3-yl]thio}-6-[(1R)-1-hydroxyethyl]-4-methyl-7-oxo-1-azabicyclo[3.2.0]hept-2-ene-2-carboxylic acid | IUPAC |
| Antibiotic SM 7338 | DrugBank |
| MEPM | ChEBI |
| Meropenem | ChemIDplus |
| meropenem anhydrous | ChemIDplus |
| Citations |
|---|