EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C17H25N3O5S.3H2O |
| Net Charge | 0 |
| Average Mass | 437.515 |
| Monoisotopic Mass | 437.18319 |
| SMILES | [H]O[H].[H]O[H].[H]O[H].[H][C@]12[C@@H](C)C(S[C@@H]3CN[C@H](C(=O)N(C)C)C3)=C(C(=O)O)N1C(=O)[C@]2([H])[C@@H](C)O |
| InChI | InChI=1S/C17H25N3O5S.3H2O/c1-7-12-11(8(2)21)16(23)20(12)13(17(24)25)14(7)26-9-5-10(18-6-9)15(22)19(3)4;;;/h7-12,18,21H,5-6H2,1-4H3,(H,24,25);3*1H2/t7-,8-,9+,10+,11-,12-;;;/m1.../s1 |
| InChIKey | CTUAQTBUVLKNDJ-OBZXMJSBSA-N |
| Roles Classification |
|---|
| Biological Role: | antibacterial drug A drug used to treat or prevent bacterial infections. |
| Application: | antibacterial drug A drug used to treat or prevent bacterial infections. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| meropenem trihydrate (CHEBI:6770) has part meropenem (CHEBI:43968) |
| meropenem trihydrate (CHEBI:6770) has role antibacterial drug (CHEBI:36047) |
| meropenem trihydrate (CHEBI:6770) is a hydrate (CHEBI:35505) |
| IUPAC Name |
|---|
| (6S)-2-{[(3S,5S)-5-(dimethylcarbamoyl)pyrrolidin-3-yl]sulfanyl}-6-[(1R)-1-hydroxyethyl]-1β-methyl-2,3-didehydro-1-carbapenam-3-carboxylic acid—water (1:3) |
| INN | Source |
|---|---|
| Meronem | DrugBank |
| Brand Name | Source |
|---|---|
| Merrem | DrugBank |
| Registry Numbers | Sources |
|---|---|
| CAS:119478-56-7 | ChemIDplus |