EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C16H18N3S |
| Net Charge | +1 |
| Average Mass | 284.408 |
| Monoisotopic Mass | 284.12159 |
| SMILES | CN(C)c1ccc2nc3ccc(N(C)C)cc3[s+]c2c1 |
| InChI | InChI=1S/C16H18N3S/c1-18(2)11-5-7-13-15(9-11)20-16-10-12(19(3)4)6-8-14(16)17-13/h5-10H,1-4H3/q+1 |
| InChIKey | RBTBFTRPCNLSDE-UHFFFAOYSA-N |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 3,7-bis(dimethylamino)phenothiazin-5-ium (CHEBI:43830) is a organic cation (CHEBI:25697) |
| 3,7-bis(dimethylamino)phenothiazin-5-ium (CHEBI:43830) is conjugate acid of 3,7-bis(dimethylamino)phenothiazine (CHEBI:78523) |
| Incoming Relation(s) |
| methylene blue (CHEBI:6872) has part 3,7-bis(dimethylamino)phenothiazin-5-ium (CHEBI:43830) |
| 3,7-bis(dimethylamino)phenothiazine (CHEBI:78523) is conjugate base of 3,7-bis(dimethylamino)phenothiazin-5-ium (CHEBI:43830) |
| IUPAC Name |
|---|
| 3,7-bis(dimethylamino)phenothiazin-5-ium |
| Synonym | Source |
|---|---|
| methylene blue cation | ChEBI |