EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C16H19N3S |
| Net Charge | 0 |
| Average Mass | 285.416 |
| Monoisotopic Mass | 285.12997 |
| SMILES | CN(C)C1=CC2Sc3cc(N(C)C)ccc3N=C2C=C1 |
| InChI | InChI=1S/C16H19N3S/c1-18(2)11-5-7-13-15(9-11)20-16-10-12(19(3)4)6-8-14(16)17-13/h5-10,15H,1-4H3 |
| InChIKey | DDCCHUHICUGJCF-UHFFFAOYSA-N |
| Roles Classification |
|---|
| Chemical Role: | Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 3,7-bis(dimethylamino)phenothiazine (CHEBI:78523) has parent hydride 4aH-phenothiazine (CHEBI:37933) |
| 3,7-bis(dimethylamino)phenothiazine (CHEBI:78523) is a phenothiazines (CHEBI:38093) |
| 3,7-bis(dimethylamino)phenothiazine (CHEBI:78523) is a tertiary amino compound (CHEBI:50996) |
| 3,7-bis(dimethylamino)phenothiazine (CHEBI:78523) is conjugate base of 3,7-bis(dimethylamino)phenothiazin-5-ium (CHEBI:43830) |
| Incoming Relation(s) |
| 3,7-bis(dimethylamino)phenothiazin-5-ium (CHEBI:43830) is conjugate acid of 3,7-bis(dimethylamino)phenothiazine (CHEBI:78523) |
| IUPAC Name |
|---|
| N,N,N',N'-tetramethyl-4aH-phenothiazine-3,7-diamine |
| Registry Numbers | Sources |
|---|---|
| Reaxys:8131736 | Reaxys |